(1aR,7aS,10aS,10bS,E)-1a-Methyl-8-methylene-5-(4-phenylpiperidine-1-carbonyl)2,3,6,7,7a,8,10a,10b-octahydrooxireno[2',3':9,10]cyclodeca[1,2-b]furan-9(1aH)-one

ID: ALA4083359

PubChem CID: 137647719

Max Phase: Preclinical

Molecular Formula: C26H31NO4

Molecular Weight: 421.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(=O)O[C@H]2[C@H]1CC/C(C(=O)N1CCC(c3ccccc3)CC1)=C\CC[C@@]1(C)O[C@@H]21

Standard InChI:  InChI=1S/C26H31NO4/c1-17-21-11-10-20(9-6-14-26(2)23(31-26)22(21)30-25(17)29)24(28)27-15-12-19(13-16-27)18-7-4-3-5-8-18/h3-5,7-9,19,21-23H,1,6,10-16H2,2H3/b20-9+/t21-,22-,23-,26+/m0/s1

Standard InChI Key:  YNZTZRMRBKZFGV-DKQNMDDYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   12.0202   -4.8384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8718   -4.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4084   -3.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2284   -3.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7150   -4.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5403   -4.0661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8364   -4.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1911   -5.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4890   -6.1359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3185   -6.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5331   -5.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5010   -4.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7403   -5.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4002   -5.7275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5220   -6.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6147   -2.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4315   -2.6999    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2959   -4.9967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8330   -6.7271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0874   -4.1974    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.9748   -6.1454    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.6216   -4.6225    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1842   -2.0308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8603   -3.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6735   -3.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0637   -2.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6344   -1.9628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8149   -1.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8773   -2.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3045   -3.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1207   -3.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5105   -2.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0782   -1.8927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2635   -1.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  5  4  1  0
 12  8  1  0
  7  6  1  0
  6  5  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  7 11  1  0
 13 12  1  0
 14 13  1  0
 12 14  1  0
 13 15  1  1
  4 16  1  0
 16 17  1  0
 11 18  2  0
 10 19  2  0
 12 20  1  1
  8 21  1  1
  7 22  1  6
 16 23  2  0
 17 24  1  0
 17 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4083359

    ---

Associated Targets(Human)

KG-1a (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.54Molecular Weight (Monoisotopic): 421.2253AlogP: 4.15#Rotatable Bonds: 2
Polar Surface Area: 59.14Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.31CX LogP: 4.17CX LogD: 4.17
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.41Np Likeness Score: 1.51

References

1. Yang Z, Kuang B, Kang N, Ding Y, Ge W, Lian L, Gao Y, Wei Y, Chen Y, Zhang Q..  (2017)  Synthesis and anti-acute myeloid leukemia activity of C-14 modified parthenolide derivatives.,  127  [PMID:28068601] [10.1016/j.ejmech.2016.12.044]

Source