The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4aR,5S,8aS)-Methyl 4-(2-(4-Chloro-3-fluorophenyl)acetyl)-5-((S)-3-hydroxypyrrolidin-1-yl)octahydroquinoxaline-1(2H)-carboxylate ID: ALA4083401
PubChem CID: 137646062
Max Phase: Preclinical
Molecular Formula: C22H29ClFN3O4
Molecular Weight: 453.94
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)N1CCN(C(=O)Cc2ccc(Cl)c(F)c2)[C@@H]2[C@@H](N3CC[C@H](O)C3)CCC[C@@H]21
Standard InChI: InChI=1S/C22H29ClFN3O4/c1-31-22(30)26-9-10-27(20(29)12-14-5-6-16(23)17(24)11-14)21-18(3-2-4-19(21)26)25-8-7-15(28)13-25/h5-6,11,15,18-19,21,28H,2-4,7-10,12-13H2,1H3/t15-,18-,19-,21+/m0/s1
Standard InChI Key: MRVTXRYQPMUXJY-LDBRAYGESA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
20.9083 -2.1109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2200 -2.8742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7125 -3.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9103 -3.3383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8852 -4.3293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1898 -4.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2204 -5.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9462 -5.9740 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9768 -6.7984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7068 -7.1820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2814 -7.2348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5513 -6.8513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6458 -5.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3717 -5.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0713 -5.4845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0407 -4.6601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3107 -4.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6153 -4.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2789 -3.4478 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9265 -2.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6402 -2.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8115 -2.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5859 -2.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4184 -1.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1073 -0.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2896 -0.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7839 -1.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0976 -2.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9753 0.1879 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.9619 -1.1337 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.1015 -1.4694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6093 -3.8821 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.6386 -6.3655 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
8 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 5 1 0
13 18 1 0
17 19 1 1
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 19 1 0
1 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 1 1 0
26 29 1 0
27 30 1 0
21 31 1 6
18 32 1 1
13 33 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.94Molecular Weight (Monoisotopic): 453.1831AlogP: 2.29#Rotatable Bonds: 3Polar Surface Area: 73.32Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.49CX LogP: 2.00CX LogD: 0.87Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.76Np Likeness Score: -0.59
References 1. Soeberdt M, Molenveld P, Storcken RP, Bouzanne des Mazery R, Sterk GJ, Autar R, Bolster MG, Wagner C, Aerts SN, van Holst FR, Wegert A, Tangherlini G, Frehland B, Schepmann D, Metze D, Lotts T, Knie U, Lin KY, Huang TY, Lai CC, Ständer S, Wünsch B, Abels C.. (2017) Design and Synthesis of Enantiomerically Pure Decahydroquinoxalines as Potent and Selective κ-Opioid Receptor Agonists with Anti-Inflammatory Activity in Vivo., 60 (6): [PMID:28218838 ] [10.1021/acs.jmedchem.6b01868 ]