4-(4-Fluorophenyl)-1,2-dihydro-2-imino-6-(4,9-dimethoxy-7-methyl-5-oxo-5H-furo[3,2-g]chromen-6-yl)pyridine-3-carbonitrile

ID: ALA4083494

PubChem CID: 137646755

Max Phase: Preclinical

Molecular Formula: C26H18FN3O5

Molecular Weight: 471.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1c2occc2c(OC)c2c(=O)c(-c3cc(-c4ccc(F)cc4)c(C#N)c(=N)[nH]3)c(C)oc12

Standard InChI:  InChI=1S/C26H18FN3O5/c1-12-19(18-10-16(17(11-28)26(29)30-18)13-4-6-14(27)7-5-13)21(31)20-22(32-2)15-8-9-34-23(15)25(33-3)24(20)35-12/h4-10H,1-3H3,(H2,29,30)

Standard InChI Key:  NLHYRLRQFAKAFM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   18.0943  -15.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0958  -14.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3853  -13.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6650  -14.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6660  -15.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3765  -15.4698    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8136  -13.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5266  -13.4201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8035  -15.4775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9488  -16.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9488  -15.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2317  -15.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5177  -15.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8048  -15.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0854  -15.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0854  -16.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8048  -16.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5177  -16.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2317  -16.6990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3009  -16.5422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3009  -15.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8174  -15.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2317  -14.2252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6660  -16.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8048  -14.2252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0854  -13.8087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3843  -12.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1015  -12.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1052  -11.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3947  -11.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6775  -11.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6738  -12.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3975  -10.5193    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.8063  -17.5240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0927  -17.9378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  1  0
  7  8  3  0
  2  7  1  0
  1  9  2  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 18 19  1  0
 10 19  1  0
 21 22  2  0
 20 22  1  0
 15 21  1  0
 16 20  1  0
 12 23  2  0
 10 24  1  0
 25 26  1  0
 14 25  1  0
  5 11  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 27 32  2  0
 30 33  1  0
  3 27  1  0
 17 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4083494

    ---

Associated Targets(Human)

MAPK13 Tchem MAP kinase p38 (1586 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.44Molecular Weight (Monoisotopic): 471.1230AlogP: 5.02#Rotatable Bonds: 4
Polar Surface Area: 125.24Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.55CX Basic pKa: 8.38CX LogP: 2.11CX LogD: 1.63
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: 0.13

References

1. Amin KM, Syam YM, Anwar MM, Ali HI, Abdel-Ghani TM, Serry AM..  (2017)  Synthesis and molecular docking studies of new furochromone derivatives as p38α MAPK inhibitors targeting human breast cancer MCF-7 cells.,  25  (8): [PMID:28291685] [10.1016/j.bmc.2017.02.065]

Source