The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-Acrylamido-4-methylphenylamino)-N-(5-(4-methoxybenzamido)-2-methylphenyl)-4-(methylamino)pyrimidine-5-carboxamide ID: ALA4083564
PubChem CID: 122633869
Max Phase: Preclinical
Molecular Formula: C31H31N7O4
Molecular Weight: 565.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2ncc(C(=O)Nc3cc(NC(=O)c4ccc(OC)cc4)ccc3C)c(NC)n2)ccc1C
Standard InChI: InChI=1S/C31H31N7O4/c1-6-27(39)36-25-16-22(12-8-18(25)2)35-31-33-17-24(28(32-4)38-31)30(41)37-26-15-21(11-7-19(26)3)34-29(40)20-9-13-23(42-5)14-10-20/h6-17H,1H2,2-5H3,(H,34,40)(H,36,39)(H,37,41)(H2,32,33,35,38)
Standard InChI Key: AILGKZBMDQBOHL-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
21.7078 -24.6189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7067 -25.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4147 -25.8474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1244 -25.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1215 -24.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4129 -24.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8277 -24.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5369 -24.6099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8246 -23.3868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2431 -24.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8327 -25.8454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8340 -26.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9508 -24.6080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6565 -24.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6538 -23.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9396 -22.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2368 -23.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5260 -22.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9986 -25.8465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9980 -26.6636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2898 -27.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2888 -27.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9968 -28.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7071 -27.8841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7046 -27.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9972 -29.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4160 -28.2908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3655 -24.6037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0719 -24.1928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7809 -24.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0692 -23.3756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7791 -25.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4873 -25.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1947 -25.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1893 -24.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4805 -24.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1226 -27.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8314 -28.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1203 -27.0630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8336 -29.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9042 -25.8171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9080 -26.6343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
4 11 1 0
11 12 1 0
10 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 10 1 0
17 18 1 0
2 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
24 27 1 0
14 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
30 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 30 1 0
27 37 1 0
37 38 1 0
37 39 2 0
38 40 2 0
34 41 1 0
41 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.63Molecular Weight (Monoisotopic): 565.2438AlogP: 5.52#Rotatable Bonds: 10Polar Surface Area: 146.37Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.80CX Basic pKa: 4.81CX LogP: 5.93CX LogD: 5.93Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.16Np Likeness Score: -1.16
References 1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J.. (2017) Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor., 60 (5): [PMID:28140585 ] [10.1021/acs.jmedchem.6b01413 ]