2-(3-Acrylamido-4-methylphenylamino)-N-(5-(4-methoxybenzamido)-2-methylphenyl)-4-(methylamino)pyrimidine-5-carboxamide

ID: ALA4083564

PubChem CID: 122633869

Max Phase: Preclinical

Molecular Formula: C31H31N7O4

Molecular Weight: 565.63

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1cc(Nc2ncc(C(=O)Nc3cc(NC(=O)c4ccc(OC)cc4)ccc3C)c(NC)n2)ccc1C

Standard InChI:  InChI=1S/C31H31N7O4/c1-6-27(39)36-25-16-22(12-8-18(25)2)35-31-33-17-24(28(32-4)38-31)30(41)37-26-15-21(11-7-19(26)3)34-29(40)20-9-13-23(42-5)14-10-20/h6-17H,1H2,2-5H3,(H,34,40)(H,36,39)(H,37,41)(H2,32,33,35,38)

Standard InChI Key:  AILGKZBMDQBOHL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
   21.7078  -24.6189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.7067  -25.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4147  -25.8474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1244  -25.4379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1215  -24.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4129  -24.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8277  -24.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5369  -24.6099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8246  -23.3868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.2431  -24.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8327  -25.8454    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8340  -26.6626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9508  -24.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6565  -24.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6538  -23.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9396  -22.9736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2368  -23.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5260  -22.9834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9986  -25.8465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9980  -26.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2898  -27.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2888  -27.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9968  -28.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7071  -27.8841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7046  -27.0690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9972  -29.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4160  -28.2908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3655  -24.6037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0719  -24.1928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7809  -24.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0692  -23.3756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7791  -25.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4873  -25.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1947  -25.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1893  -24.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4805  -24.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1226  -27.8802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8314  -28.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1203  -27.0630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8336  -29.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9042  -25.8171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9080  -26.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
  4 11  1  0
 11 12  1  0
 10 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 10  1  0
 17 18  1  0
  2 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 24 27  1  0
 14 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 30  1  0
 27 37  1  0
 37 38  1  0
 37 39  2  0
 38 40  2  0
 34 41  1  0
 41 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4083564

    ---

Associated Targets(Human)

BMX Tchem Tyrosine-protein kinase BMX (1995 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

BaF3 (4657 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 565.63Molecular Weight (Monoisotopic): 565.2438AlogP: 5.52#Rotatable Bonds: 10
Polar Surface Area: 146.37Molecular Species: NEUTRALHBA: 8HBD: 5
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 3
CX Acidic pKa: 12.80CX Basic pKa: 4.81CX LogP: 5.93CX LogD: 5.93
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.16Np Likeness Score: -1.16

References

1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J..  (2017)  Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor.,  60  (5): [PMID:28140585] [10.1021/acs.jmedchem.6b01413]

Source