The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-methoxy-2-(trifluoromethyl)benzyl)-1-propionylpiperidine-4-carboxamide ID: ALA4083949
PubChem CID: 133081968
Product Number: M612009, Order Now?
Max Phase: Preclinical
Molecular Formula: C18H23F3N2O3
Molecular Weight: 372.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)N1CCC(C(=O)NCc2ccc(OC)cc2C(F)(F)F)CC1
Standard InChI: InChI=1S/C18H23F3N2O3/c1-3-16(24)23-8-6-12(7-9-23)17(25)22-11-13-4-5-14(26-2)10-15(13)18(19,20)21/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,22,25)
Standard InChI Key: IJNCJYJSEFDKFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
31.9805 -22.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9793 -23.5605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6874 -23.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3970 -23.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3942 -22.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6856 -22.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1004 -22.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8096 -22.7321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5158 -22.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2250 -22.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5127 -21.5036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6831 -21.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3896 -21.1042 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.9742 -21.1085 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.6753 -20.6939 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.2713 -23.9686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5639 -23.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2258 -23.5425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9309 -23.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6395 -23.5405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6384 -22.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9287 -22.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3472 -23.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3472 -24.7663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0549 -23.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7626 -23.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
6 12 1 0
12 13 1 0
12 14 1 0
12 15 1 0
2 16 1 0
16 17 1 0
10 18 1 0
10 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 372.39Molecular Weight (Monoisotopic): 372.1661AlogP: 2.98#Rotatable Bonds: 5Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.05CX LogD: 2.05Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.86Np Likeness Score: -1.63
References 1. Blöcher R, Wagner KM, Gopireddy RR, Harris TR, Wu H, Barnych B, Hwang SH, Xiang YK, Proschak E, Morisseau C, Hammock BD.. (2018) Orally Available Soluble Epoxide Hydrolase/Phosphodiesterase 4 Dual Inhibitor Treats Inflammatory Pain., 61 (8): [PMID:29614224 ] [10.1021/acs.jmedchem.7b01804 ]