The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(Methylsulfanyl)-8-(beta-D-ribofuranosyl)-8H-thieno[2',3':4,5]-pyrrolo[2,3-d]pyrimidine-5'-O-monophosphate Sodium Salt ID: ALA4084001
PubChem CID: 137646313
Max Phase: Preclinical
Molecular Formula: C14H15N3NaO7PS2
Molecular Weight: 433.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ncnc2c1c1sccc1n2[C@@H]1O[C@H](COP(=O)([O-])O)[C@@H](O)[C@H]1O.[Na+]
Standard InChI: InChI=1S/C14H16N3O7PS2.Na/c1-26-13-8-11-6(2-3-27-11)17(12(8)15-5-16-13)14-10(19)9(18)7(24-14)4-23-25(20,21)22;/h2-3,5,7,9-10,14,18-19H,4H2,1H3,(H2,20,21,22);/q;+1/p-1/t7-,9-,10-,14-;/m1./s1
Standard InChI Key: XYDBUVLKGXAXGU-WPPLYIOHSA-M
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
26.6027 -2.8130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6027 -3.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3125 -4.0494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0264 -3.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0264 -2.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3098 -2.4005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3098 -1.5761 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.0194 -1.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8102 -2.5472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2990 -3.2156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8179 -3.8846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0782 -4.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6022 -5.3338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0888 -5.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8745 -5.7380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8745 -4.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5298 -4.4258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5441 -6.2201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8394 -6.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0358 -6.9605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7863 -7.7469 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
26.9785 -7.9226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3406 -8.3574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7863 -8.5685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0795 -2.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0795 -2.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2926 -1.8784 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
26.5095 -9.1500 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
5 4 2 0
5 6 1 0
6 1 2 0
6 7 1 0
7 8 1 0
9 5 1 0
9 10 2 0
11 10 1 0
4 11 1 0
12 11 1 1
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
16 17 1 6
15 18 1 6
14 19 1 1
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
21 24 1 0
10 25 1 0
25 26 2 0
26 27 1 0
27 9 1 0
M CHG 2 24 -1 28 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.40Molecular Weight (Monoisotopic): 433.0167AlogP: 1.10#Rotatable Bonds: 5Polar Surface Area: 147.16Molecular Species: ACIDHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 0.22CX Basic pKa: 5.13CX LogP: -2.11CX LogD: -2.57Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.26Np Likeness Score: 0.07
References 1. Tichý M, Smoleń S, Tloušt'ová E, Pohl R, Oždian T, Hejtmánková K, Lišková B, Gurská S, Džubák P, Hajdúch M, Hocek M.. (2017) Synthesis and Cytostatic and Antiviral Profiling of Thieno-Fused 7-Deazapurine Ribonucleosides., 60 (6): [PMID:28221790 ] [10.1021/acs.jmedchem.6b01766 ]