The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(6H-indolo[2,3-b]quinoxalin-6-yl)-N-(3-morpholinopropyl)butanamide ID: ALA4084035
PubChem CID: 137647973
Max Phase: Preclinical
Molecular Formula: C25H29N5O2
Molecular Weight: 431.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCn1c2ccccc2c2nc3ccccc3nc21)NCCCN1CCOCC1
Standard InChI: InChI=1S/C25H29N5O2/c31-23(26-12-6-13-29-15-17-32-18-16-29)11-5-14-30-22-10-4-1-7-19(22)24-25(30)28-21-9-3-2-8-20(21)27-24/h1-4,7-10H,5-6,11-18H2,(H,26,31)
Standard InChI Key: OABXSOCXARRUCJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
27.3869 -1.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3857 -2.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0938 -2.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0920 -1.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8006 -1.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8014 -2.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5099 -2.8816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5043 -1.2453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2134 -1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2211 -2.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0024 -2.7136 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9901 -1.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4755 -2.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2864 -1.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6129 -1.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1224 -0.5464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3132 -0.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2629 -3.4882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0640 -3.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3245 -4.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1255 -4.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3860 -5.3606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6660 -3.9731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8455 -5.9735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0445 -5.8118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5039 -6.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7029 -6.2630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4451 -5.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6480 -5.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1040 -5.9364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3630 -6.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1659 -6.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 10 2 0
9 8 2 0
8 5 1 0
9 10 1 0
10 11 1 0
11 13 1 0
12 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
11 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.54Molecular Weight (Monoisotopic): 431.2321AlogP: 3.36#Rotatable Bonds: 8Polar Surface Area: 72.28Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.00CX LogP: 2.67CX LogD: 2.53Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.41
References 1. Klimenko K, Lyakhov S, Shibinskaya M, Karpenko A, Marcou G, Horvath D, Zenkova M, Goncharova E, Amirkhanov R, Krysko A, Andronati S, Levandovskiy I, Polishchuk P, Kuz'min V, Varnek A.. (2017) Virtual screening, synthesis and biological evaluation of DNA intercalating antiviral agents., 27 (16): [PMID:28666733 ] [10.1016/j.bmcl.2017.06.035 ]