The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)butyl)-4-nitro-3-(trifluoromethyl)aniline ID: ALA4084057
PubChem CID: 137645149
Max Phase: Preclinical
Molecular Formula: C22H26F3N3O4
Molecular Weight: 453.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(CCCCNc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)CC2
Standard InChI: InChI=1S/C22H26F3N3O4/c1-31-20-11-15-7-10-27(14-16(15)12-21(20)32-2)9-4-3-8-26-17-5-6-19(28(29)30)18(13-17)22(23,24)25/h5-6,11-13,26H,3-4,7-10,14H2,1-2H3
Standard InChI Key: KMLBJUJNEUQEJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
23.3463 -14.0821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3452 -14.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0532 -15.3106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7629 -14.9011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7600 -14.0785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0514 -13.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4683 -13.6659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4653 -12.8487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1776 -14.0718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6371 -15.3096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4712 -15.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4725 -16.1258 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.1783 -14.8989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.1749 -15.7165 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.9298 -14.9005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2217 -15.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5143 -14.8994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8063 -15.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0989 -14.8982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0799 -14.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3650 -13.6893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4071 -15.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6916 -14.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6696 -14.1148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9486 -13.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2491 -14.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2752 -14.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9966 -15.3655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5809 -15.4105 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8605 -15.0247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5296 -13.7679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8343 -14.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
7 9 1 0
5 7 1 0
2 10 1 0
4 11 1 0
11 12 1 0
11 13 1 0
11 14 1 0
10 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 22 1 0
20 21 1 0
21 24 1 0
23 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
27 29 1 0
29 30 1 0
26 31 1 0
31 32 1 0
M CHG 2 7 1 9 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.46Molecular Weight (Monoisotopic): 453.1875AlogP: 4.88#Rotatable Bonds: 9Polar Surface Area: 76.87Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.23CX LogP: 4.31CX LogD: 3.42Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: -1.20
References 1. Amata E, Dichiara M, Arena E, Pittalà V, Pistarà V, Cardile V, Graziano ACE, Fraix A, Marrazzo A, Sortino S, Prezzavento O.. (2017) Novel Sigma Receptor Ligand-Nitric Oxide Photodonors: Molecular Hybrids for Double-Targeted Antiproliferative Effect., 60 (23): [PMID:29172528 ] [10.1021/acs.jmedchem.7b00791 ]