The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-Aminomethyl)-N-(3-(6-(3-(pyrrolidin-1-yl)propoxy)benzo[d]oxazol-2-yl)phenyl)-benzamide ID: ALA4084216
PubChem CID: 137645168
Max Phase: Preclinical
Molecular Formula: C28H30N4O3
Molecular Weight: 470.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NCc1ccc(C(=O)Nc2cccc(-c3nc4ccc(OCCCN5CCCC5)cc4o3)c2)cc1
Standard InChI: InChI=1S/C28H30N4O3/c29-19-20-7-9-21(10-8-20)27(33)30-23-6-3-5-22(17-23)28-31-25-12-11-24(18-26(25)35-28)34-16-4-15-32-13-1-2-14-32/h3,5-12,17-18H,1-2,4,13-16,19,29H2,(H,30,33)
Standard InChI Key: VMVCZHWEWHVJHV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
17.3649 -11.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7735 -11.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3649 -12.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7735 -13.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5907 -13.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9993 -12.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5907 -11.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7735 -10.3051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5477 -11.0076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1391 -11.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3219 -11.7141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9133 -12.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3219 -13.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1391 -13.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5477 -12.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6118 -13.0864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0961 -12.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6118 -11.7632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8387 -12.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8387 -12.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1296 -13.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4206 -12.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4206 -12.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1296 -11.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7115 -13.2420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0065 -12.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2974 -13.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5925 -12.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8834 -13.2420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7993 -14.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9968 -14.2254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5882 -13.5188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1361 -12.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9993 -13.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8164 -13.8420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
16 20 1 0
21 22 1 0
22 23 2 0
23 24 1 0
19 24 2 0
20 21 2 0
26 27 1 0
27 28 1 0
25 26 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
29 33 1 0
28 29 1 0
22 25 1 0
12 17 1 0
9 10 1 0
34 35 1 0
5 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.57Molecular Weight (Monoisotopic): 470.2318AlogP: 5.07#Rotatable Bonds: 9Polar Surface Area: 93.62Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.51CX LogP: 3.89CX LogD: 0.30Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.60
References 1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A.. (2017) Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism., 134 [PMID:28437629 ] [10.1016/j.ejmech.2017.03.086 ]