(4-Aminomethyl)-N-(3-(6-(3-(pyrrolidin-1-yl)propoxy)benzo[d]oxazol-2-yl)phenyl)-benzamide

ID: ALA4084216

PubChem CID: 137645168

Max Phase: Preclinical

Molecular Formula: C28H30N4O3

Molecular Weight: 470.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCc1ccc(C(=O)Nc2cccc(-c3nc4ccc(OCCCN5CCCC5)cc4o3)c2)cc1

Standard InChI:  InChI=1S/C28H30N4O3/c29-19-20-7-9-21(10-8-20)27(33)30-23-6-3-5-22(17-23)28-31-25-12-11-24(18-26(25)35-28)34-16-4-15-32-13-1-2-14-32/h3,5-12,17-18H,1-2,4,13-16,19,29H2,(H,30,33)

Standard InChI Key:  VMVCZHWEWHVJHV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   17.3649  -11.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7735  -11.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3649  -12.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7735  -13.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5907  -13.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9993  -12.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5907  -11.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7735  -10.3051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5477  -11.0076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1391  -11.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3219  -11.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9133  -12.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3219  -13.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1391  -13.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5477  -12.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6118  -13.0864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0961  -12.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6118  -11.7632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8387  -12.0162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8387  -12.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1296  -13.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4206  -12.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4206  -12.0162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1296  -11.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7115  -13.2420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0065  -12.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2974  -13.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5925  -12.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8834  -13.2420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7993  -14.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9968  -14.2254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5882  -13.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1361  -12.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9993  -13.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8164  -13.8420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 16 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 19 24  2  0
 20 21  2  0
 26 27  1  0
 27 28  1  0
 25 26  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 29 33  1  0
 28 29  1  0
 22 25  1  0
 12 17  1  0
  9 10  1  0
 34 35  1  0
  5 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4084216

    ---

Associated Targets(Human)

TLR9 Tclin Toll-like receptor 9 (943 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TLR7 Tclin Toll-like receptor 7 (2626 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.57Molecular Weight (Monoisotopic): 470.2318AlogP: 5.07#Rotatable Bonds: 9
Polar Surface Area: 93.62Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.51CX LogP: 3.89CX LogD: 0.30
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: -1.60

References

1. Roy S, Mukherjee A, Paul B, Rahaman O, Roy S, Maithri G, Ramya B, Pal S, Ganguly D, Talukdar A..  (2017)  Design and development of benzoxazole derivatives with toll-like receptor 9 antagonism.,  134  [PMID:28437629] [10.1016/j.ejmech.2017.03.086]

Source