The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-((6-(2-(4-chloro-2-fluorophenyl)-1,1-difluoro-2-hydroxy-3-(1H-tetrazol-1-yl)propyl)pyridin-3-yl)ethynyl)phenoxy)methyl)benzonitrile ID: ALA4084305
PubChem CID: 71621494
Max Phase: Preclinical
Molecular Formula: C31H20ClF3N6O2
Molecular Weight: 600.99
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(COc2ccc(C#Cc3ccc(C(F)(F)C(O)(Cn4cnnn4)c4ccc(Cl)cc4F)nc3)cc2)cc1
Standard InChI: InChI=1S/C31H20ClF3N6O2/c32-25-10-13-27(28(33)15-25)30(42,19-41-20-38-39-40-41)31(34,35)29-14-9-23(17-37-29)4-1-21-7-11-26(12-8-21)43-18-24-5-2-22(16-36)3-6-24/h2-3,5-15,17,20,42H,18-19H2
Standard InChI Key: QGGPBLYNUKQPLU-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
3.7888 -18.5106 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.7929 -19.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4986 -18.9156 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.0830 -19.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3712 -19.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0830 -20.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5067 -19.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3689 -20.9727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3686 -21.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0809 -22.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7951 -21.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7920 -20.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3712 -18.5106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0345 -18.0276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7820 -17.2463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9606 -17.2463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7041 -18.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0789 -18.9233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5042 -20.5670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2152 -20.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9239 -20.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9212 -19.7414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2138 -19.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6349 -20.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3473 -21.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0597 -21.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0588 -22.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7704 -23.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4826 -22.6080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4789 -21.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7668 -21.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6625 -20.5619 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.1918 -23.0141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8980 -22.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6072 -23.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6059 -23.8234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3142 -24.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0215 -23.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0159 -22.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3070 -22.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0820 -23.0240 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.7277 -24.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4374 -24.6257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
4 5 1 0
4 6 1 0
2 7 1 0
6 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 6 1 0
5 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
4 18 1 0
7 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 7 1 0
24 25 3 0
21 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
8 32 1 0
29 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
10 41 1 0
42 43 3 0
38 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 600.99Molecular Weight (Monoisotopic): 600.1288AlogP: 5.39#Rotatable Bonds: 8Polar Surface Area: 109.74Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.66CX Basic pKa: 0.32CX LogP: 6.25CX LogD: 6.25Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.24Np Likeness Score: -1.51
References 1. Yates CM, Garvey EP, Shaver SR, Schotzinger RJ, Hoekstra WJ.. (2017) Design and optimization of highly-selective, broad spectrum fungal CYP51 inhibitors., 27 (15): [PMID:28651982 ] [10.1016/j.bmcl.2017.06.037 ]