The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(4-((S)-3-(((R)-1-(naphthalen-1-yl)ethyl)amino)pyrrolidin-1-yl)phenylsulfonamido)ethyl)-1H-imidazole-4,5-dicarboxylic acid ID: ALA4084641
PubChem CID: 137645663
Max Phase: Preclinical
Molecular Formula: C29H31N5O6S
Molecular Weight: 577.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](N[C@H]1CCN(c2ccc(S(=O)(=O)NCCn3cnc(C(=O)O)c3C(=O)O)cc2)C1)c1cccc2ccccc12
Standard InChI: InChI=1S/C29H31N5O6S/c1-19(24-8-4-6-20-5-2-3-7-25(20)24)32-21-13-15-33(17-21)22-9-11-23(12-10-22)41(39,40)31-14-16-34-18-30-26(28(35)36)27(34)29(37)38/h2-12,18-19,21,31-32H,13-17H2,1H3,(H,35,36)(H,37,38)/t19-,21+/m1/s1
Standard InChI Key: XQVAZARINDDSNF-CTNGQTDRSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
13.8510 -3.7434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4465 -4.4533 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.2635 -4.4486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6624 -3.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6612 -4.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0761 -3.5788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3675 -3.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0789 -4.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3684 -4.8087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3669 -5.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0751 -6.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7863 -5.6243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7843 -4.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4915 -4.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1998 -4.8068 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4905 -3.5819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9069 -4.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6543 -4.7267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2003 -4.1187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7908 -3.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9917 -3.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0131 -4.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3422 -4.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1542 -5.0352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6346 -4.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2971 -3.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4861 -3.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7819 -5.2020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3033 -5.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6376 -6.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1590 -7.2724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3434 -7.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0929 -8.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7553 -8.5312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4151 -8.0491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8613 -6.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1916 -5.8675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0488 -6.7026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3164 -8.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7077 -7.7619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1486 -9.1069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 9 1 0
8 6 1 0
6 7 2 0
7 4 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
13 14 1 0
14 15 1 0
14 16 1 1
17 15 1 1
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 1 0
19 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 2 1 0
2 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 31 1 0
32 36 1 0
36 37 2 0
36 38 1 0
33 39 1 0
39 40 2 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.66Molecular Weight (Monoisotopic): 577.1995AlogP: 3.34#Rotatable Bonds: 11Polar Surface Area: 153.86Molecular Species: ZWITTERIONHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.49CX Basic pKa: 9.42CX LogP: 0.51CX LogD: -1.77Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.21Np Likeness Score: -1.41
References 1. Sparks SM, Spearing PK, Diaz CJ, Cowan DJ, Jayawickreme C, Chen G, Rimele TJ, Generaux C, Harston LT, Roller SG.. (2017) Identification of potent, nonabsorbable agonists of the calcium-sensing receptor for GI-specific administration., 27 (20): [PMID:28916340 ] [10.1016/j.bmcl.2017.09.008 ]