The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-Chlorobenzylidene)amino)-N-(3-(2-(4-chlorobenzylidene)hydrazinyl)-3-oxopropyl)benzamide ID: ALA4084724
PubChem CID: 137645668
Max Phase: Preclinical
Molecular Formula: C24H20Cl2N4O2
Molecular Weight: 467.36
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCNC(=O)c1ccccc1/N=C/c1ccc(Cl)cc1)N/N=C/c1ccc(Cl)cc1
Standard InChI: InChI=1S/C24H20Cl2N4O2/c25-19-9-5-17(6-10-19)15-28-22-4-2-1-3-21(22)24(32)27-14-13-23(31)30-29-16-18-7-11-20(26)12-8-18/h1-12,15-16H,13-14H2,(H,27,32)(H,30,31)/b28-15+,29-16+
Standard InChI Key: ZLEJUKDSKBBBOJ-QSXCDPBRSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
6.9093 -4.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6441 -4.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6430 -5.3347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3552 -5.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3534 -4.0980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0661 -4.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0650 -5.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7774 -4.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4898 -4.5055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7763 -3.2724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7774 -5.7398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7786 -6.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4910 -6.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4876 -7.7933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1992 -8.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9073 -7.7911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9035 -6.9656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1955 -6.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6203 -8.1978 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2011 -4.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6183 -4.0972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3247 -4.5079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6207 -3.2800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0337 -4.1014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7402 -4.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4491 -4.1057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1528 -4.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8613 -4.1111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8642 -3.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1527 -2.8824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4472 -3.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5726 -2.8856 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
6 8 1 0
8 9 1 0
8 10 2 0
7 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
9 20 1 0
20 1 1 0
1 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.36Molecular Weight (Monoisotopic): 466.0963AlogP: 5.01#Rotatable Bonds: 8Polar Surface Area: 82.92Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.84CX Basic pKa: 1.36CX LogP: 5.18CX LogD: 5.18Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.54
References 1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A.. (2017) Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives., 27 (4): [PMID:28087274 ] [10.1016/j.bmcl.2017.01.003 ]