2-((4-Chlorobenzylidene)amino)-N-(3-(2-(4-chlorobenzylidene)hydrazinyl)-3-oxopropyl)benzamide

ID: ALA4084724

PubChem CID: 137645668

Max Phase: Preclinical

Molecular Formula: C24H20Cl2N4O2

Molecular Weight: 467.36

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCNC(=O)c1ccccc1/N=C/c1ccc(Cl)cc1)N/N=C/c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C24H20Cl2N4O2/c25-19-9-5-17(6-10-19)15-28-22-4-2-1-3-21(22)24(32)27-14-13-23(31)30-29-16-18-7-11-20(26)12-8-18/h1-12,15-16H,13-14H2,(H,27,32)(H,30,31)/b28-15+,29-16+

Standard InChI Key:  ZLEJUKDSKBBBOJ-QSXCDPBRSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    6.9093   -4.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6441   -4.5110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6430   -5.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3552   -5.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3534   -4.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0661   -4.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0650   -5.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7774   -4.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4898   -4.5055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7763   -3.2724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7774   -5.7398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7786   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4910   -6.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4876   -7.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1992   -8.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9073   -7.7911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9035   -6.9656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1955   -6.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6203   -8.1978    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.2011   -4.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6183   -4.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3247   -4.5079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6207   -3.2800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0337   -4.1014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7402   -4.5122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4491   -4.1057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1528   -4.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8613   -4.1111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8642   -3.2930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1527   -2.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4472   -3.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5726   -2.8856    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  8 10  2  0
  7 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 16 19  1  0
  9 20  1  0
 20  1  1  0
  1 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4084724

    ---

Associated Targets(non-human)

Leishmania aethiopica (127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 467.36Molecular Weight (Monoisotopic): 466.0963AlogP: 5.01#Rotatable Bonds: 8
Polar Surface Area: 82.92Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.84CX Basic pKa: 1.36CX LogP: 5.18CX LogD: 5.18
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.54

References

1. Khattab SN, Haiba NS, Asal AM, Bekhit AA, Guemei AA, Amer A, El-Faham A..  (2017)  Study of antileishmanial activity of 2-aminobenzoyl amino acid hydrazides and their quinazoline derivatives.,  27  (4): [PMID:28087274] [10.1016/j.bmcl.2017.01.003]

Source