The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3aS,5aS,8S,9R,9bS)-5a,9-Dimethyl-3-methylene-2-oxododecahydronaphtho[1,2-b]furan-8-yl (E)-3-(Furan-2-yl)-acrylate ID: ALA4084838
PubChem CID: 137647541
Max Phase: Preclinical
Molecular Formula: C22H26O5
Molecular Weight: 370.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)O[C@@H]2C3[C@@H](C)[C@@H](OC(=O)/C=C/c4ccco4)CC[C@]3(C)CC[C@@H]12
Standard InChI: InChI=1S/C22H26O5/c1-13-16-8-10-22(3)11-9-17(14(2)19(22)20(16)27-21(13)24)26-18(23)7-6-15-5-4-12-25-15/h4-7,12,14,16-17,19-20H,1,8-11H2,2-3H3/b7-6+/t14-,16-,17-,19?,20-,22-/m0/s1
Standard InChI Key: MVTSDHIYWUJXDM-ATQIMCTJSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
10.0225 -12.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0225 -13.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7361 -13.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7361 -12.0694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4497 -12.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4463 -13.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8786 -12.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1636 -12.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8751 -13.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1572 -13.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3230 -14.5357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1434 -14.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4819 -13.8742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4424 -11.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7283 -14.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3070 -13.7269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5904 -13.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8790 -13.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5892 -12.4908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5502 -15.3451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2912 -13.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5889 -12.8997 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.5670 -14.3114 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.1664 -13.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4551 -13.7311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7065 -13.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1573 -14.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5695 -14.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3732 -14.5512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 8 1 0
6 10 1 0
9 7 1 0
7 8 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
9 13 1 0
5 14 1 1
3 15 1 1
2 16 1 1
16 17 1 0
17 18 1 0
17 19 2 0
12 20 2 0
13 21 2 0
9 22 1 6
10 23 1 1
18 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.45Molecular Weight (Monoisotopic): 370.1780AlogP: 4.15#Rotatable Bonds: 3Polar Surface Area: 65.74Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.57CX LogD: 4.57Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: 2.10
References 1. Chen H, Wu G, Gao S, Guo R, Zhao Z, Yuan H, Liu S, Wu J, Lu X, Yuan X, Yu Z, Zu X, Xie N, Yang N, Hu Z, Sun Q, Zhang W.. (2017) Discovery of Potent Small-Molecule Inhibitors of Ubiquitin-Conjugating Enzyme UbcH5c from α-Santonin Derivatives., 60 (16): [PMID:28696694 ] [10.1021/acs.jmedchem.6b01829 ]