The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(5-chloro-1-methyl-2-undecyl-1H-indol-3-yl)-3-methyl-5-oxopentanoic acid ID: ALA4084871
PubChem CID: 137647550
Max Phase: Preclinical
Molecular Formula: C26H38ClNO3
Molecular Weight: 448.05
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCc1c(C(=O)CC(C)CC(=O)O)c2cc(Cl)ccc2n1C
Standard InChI: InChI=1S/C26H38ClNO3/c1-4-5-6-7-8-9-10-11-12-13-23-26(24(29)16-19(2)17-25(30)31)21-18-20(27)14-15-22(21)28(23)3/h14-15,18-19H,4-13,16-17H2,1-3H3,(H,30,31)
Standard InChI Key: ZFSQWBIXSAVANK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
6.9833 -17.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6296 -20.7652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1243 -20.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6557 -19.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8575 -20.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8754 -19.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1798 -19.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4659 -19.6544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4519 -20.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1481 -20.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7661 -19.2324 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.8661 -21.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9216 -18.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7237 -18.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3853 -18.0527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7918 -17.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0576 -16.8117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8598 -16.6556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5214 -16.1950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9413 -20.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3645 -19.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1815 -19.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6047 -18.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4217 -18.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8449 -18.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4466 -17.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6619 -18.0853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0852 -17.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9022 -17.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3254 -16.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1424 -16.7211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 2 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
2 12 1 0
4 13 1 0
13 14 1 0
13 15 2 0
14 1 1 0
1 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
3 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
1 26 1 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.05Molecular Weight (Monoisotopic): 447.2540AlogP: 7.59#Rotatable Bonds: 15Polar Surface Area: 59.30Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.35CX Basic pKa: ┄CX LogP: 7.74CX LogD: 4.81Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.23Np Likeness Score: -0.04
References 1. Ye Q, Chourey S, Wang R, Chintam NR, Gravel S, Powell WS, Rokach J.. (2017) Structure-activity relationship study of β-oxidation resistant indole-based 5-oxo-6,8,11,14-eicosatetraenoic acid (5-oxo-ETE) receptor antagonists., 27 (20): [PMID:28943042 ] [10.1016/j.bmcl.2017.08.034 ]