The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-Mercapto-N-(2-(thiazol-2-yl)ethyl)-1,5-naphthyridine-3-carboxamide ID: ALA4085174
PubChem CID: 137648465
Max Phase: Preclinical
Molecular Formula: C28H22N8O2S4
Molecular Weight: 630.81
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCc1nccs1)c1cnc2c(SSc3ccnc4cc(C(=O)NCCc5nccs5)cnc34)ccnc2c1
Standard InChI: InChI=1S/C28H22N8O2S4/c37-27(33-7-3-23-31-9-11-39-23)17-13-19-25(35-15-17)21(1-5-29-19)41-42-22-2-6-30-20-14-18(16-36-26(20)22)28(38)34-8-4-24-32-10-12-40-24/h1-2,5-6,9-16H,3-4,7-8H2,(H,33,37)(H,34,38)
Standard InChI Key: OFNQVOGOMOJAMR-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
23.0987 -16.8803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0975 -17.6999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8056 -18.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8038 -16.4715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5124 -16.8767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5132 -17.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2217 -18.1028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9300 -17.6920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9252 -16.8699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2161 -16.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8075 -18.9260 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.1007 -19.3363 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.1026 -20.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1032 -21.7838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8123 -21.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8072 -20.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3940 -21.3760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3931 -20.5632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6899 -20.1593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9871 -20.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9919 -21.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6957 -21.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6304 -16.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3406 -16.8612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6255 -15.6398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2868 -21.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5765 -21.3919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2919 -22.6132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0458 -16.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8714 -21.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1611 -21.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7560 -16.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4612 -16.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4560 -21.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2091 -16.7661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7522 -16.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3393 -15.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5410 -15.6251 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.7088 -21.4882 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.1658 -22.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5788 -22.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3770 -22.6291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 1 0
11 12 1 0
12 13 1 0
13 18 2 0
17 14 2 0
14 15 1 0
15 16 2 0
16 13 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
23 25 2 0
21 26 1 0
26 27 1 0
26 28 2 0
24 29 1 0
27 30 1 0
30 31 1 0
29 32 1 0
32 33 1 0
31 34 1 0
33 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 33 1 0
34 39 1 0
39 40 1 0
40 41 2 0
41 42 1 0
42 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 630.81Molecular Weight (Monoisotopic): 630.0749AlogP: 5.23#Rotatable Bonds: 11Polar Surface Area: 135.54Molecular Species: NEUTRALHBA: 12HBD: 2#RO5 Violations: 3HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.35CX Basic pKa: 2.94CX LogP: 2.76CX LogD: 2.76Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.18Np Likeness Score: -0.93
References 1. Perez C, Li J, Parlati F, Rouffet M, Ma Y, Mackinnon AL, Chou TF, Deshaies RJ, Cohen SM.. (2017) Discovery of an Inhibitor of the Proteasome Subunit Rpn11., 60 (4): [PMID:28191850 ] [10.1021/acs.jmedchem.6b01379 ]