The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R,5R,9S)-(-)-5-(3-Hydroxyphenyl)-2-(4-nitrophenethyl)-2-azabicyclo[3.3.1]nonan-9-ol oxalate ID: ALA4085431
PubChem CID: 137648270
Max Phase: Preclinical
Molecular Formula: C24H28N2O8
Molecular Weight: 382.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(=O)O.O=[N+]([O-])c1ccc(CCN2CC[C@@]3(c4cccc(O)c4)CCC[C@@H]2[C@H]3O)cc1
Standard InChI: InChI=1S/C22H26N2O4.C2H2O4/c25-19-4-1-3-17(15-19)22-11-2-5-20(21(22)26)23(14-12-22)13-10-16-6-8-18(9-7-16)24(27)28;3-1(4)2(5)6/h1,3-4,6-9,15,20-21,25-26H,2,5,10-14H2;(H,3,4)(H,5,6)/t20-,21-,22-;/m1./s1
Standard InChI Key: HHZWUDAEAJEIIA-AFYLVLOISA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
11.0488 -7.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7565 -6.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4642 -7.0695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7565 -5.8437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3411 -6.6609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0488 -7.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8532 -6.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8532 -7.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5685 -7.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2769 -7.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2769 -6.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5685 -6.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1418 -6.0355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1391 -5.2112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4237 -4.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7098 -5.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7181 -6.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4281 -6.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4186 -3.9730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5685 -5.2043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5689 -6.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8491 -7.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4147 -6.1023 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0707 -5.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8361 -5.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4921 -5.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2478 -5.7358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9070 -5.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7984 -4.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0318 -4.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3805 -4.6034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4525 -3.9086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3447 -3.0866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2189 -4.2232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3509 -5.5979 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 2 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
7 13 1 6
15 19 1 0
12 20 1 6
7 21 1 0
21 22 1 0
11 23 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 2 0
32 34 1 0
29 32 1 0
11 35 1 1
M CHG 2 32 1 34 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.46Molecular Weight (Monoisotopic): 382.1893AlogP: 3.40#Rotatable Bonds: 5Polar Surface Area: 86.84Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.06CX Basic pKa: 9.16CX LogP: 3.59CX LogD: 2.13Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.61Np Likeness Score: 0.27
References 1. Truong PM, Hassan SA, Lee YS, Kopajtic TA, Katz JL, Chadderdon AM, Traynor JR, Deschamps JR, Jacobson AE, Rice KC.. (2017) Modulation of opioid receptor affinity and efficacy via N-substitution of 9β-hydroxy-5-(3-hydroxyphenyl)morphan: Synthesis and computer simulation study., 25 (8): [PMID:28314512 ] [10.1016/j.bmc.2017.02.064 ]