The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-Isopropyl 6-Diazo-5-oxo-2-(((phenyl(pivaloyloxy)methoxy)carbonyl)amino)hexanoate ID: ALA4085730
PubChem CID: 137033613
Max Phase: Preclinical
Molecular Formula: C22H29N3O7
Molecular Weight: 447.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)OC(OC(=O)C(C)(C)C)c1ccccc1
Standard InChI: InChI=1S/C22H29N3O7/c1-14(2)30-18(27)17(12-11-16(26)13-24-23)25-21(29)32-19(15-9-7-6-8-10-15)31-20(28)22(3,4)5/h6-10,13-14,17,19H,11-12H2,1-5H3,(H,25,29)/t17-,19?/m0/s1
Standard InChI Key: QQIBFRQTTLIECS-KKFHFHRHSA-N
Molfile:
RDKit 2D
32 32 0 0 0 0 0 0 0 0999 V2000
11.0167 -7.6501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7312 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -7.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1601 -7.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -8.4751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7312 -6.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4457 -5.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1601 -4.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7312 -4.7625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8746 -5.1750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5792 -5.5861 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3023 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5878 -7.6501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3023 -6.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8733 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1589 -7.6501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4444 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7298 -7.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4444 -6.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0154 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7298 -8.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0125 -8.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8746 -7.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5891 -7.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8746 -8.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8733 -6.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5913 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5916 -5.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8767 -4.7664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1598 -5.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1630 -6.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
2 6 1 1
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 2 0
1 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
19 22 1 0
19 23 1 0
4 24 1 0
24 25 1 0
24 26 1 0
16 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M CHG 2 11 1 12 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.49Molecular Weight (Monoisotopic): 447.2006AlogP: 2.97#Rotatable Bonds: 10Polar Surface Area: 144.40Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.99CX Basic pKa: ┄CX LogP: 2.94CX LogD: 2.93Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.19Np Likeness Score: 0.03
References 1. Nedelcovych MT, Tenora L, Kim BH, Kelschenbach J, Chao W, Hadas E, Jančařík A, Prchalová E, Zimmermann SC, Dash RP, Gadiano AJ, Garrett C, Furtmüller G, Oh B, Brandacher G, Alt J, Majer P, Volsky DJ, Rais R, Slusher BS.. (2017) N-(Pivaloyloxy)alkoxy-carbonyl Prodrugs of the Glutamine Antagonist 6-Diazo-5-oxo-l-norleucine (DON) as a Potential Treatment for HIV Associated Neurocognitive Disorders., 60 (16): [PMID:28759224 ] [10.1021/acs.jmedchem.7b00966 ]