Dimethyl 8,8'-Disulfanediylbis(quinoline-2-carboxylate)

ID: ALA4085742

PubChem CID: 137642637

Max Phase: Preclinical

Molecular Formula: C22H16N2O4S2

Molecular Weight: 436.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc2cccc(SSc3cccc4ccc(C(=O)OC)nc34)c2n1

Standard InChI:  InChI=1S/C22H16N2O4S2/c1-27-21(25)15-11-9-13-5-3-7-17(19(13)23-15)29-30-18-8-4-6-14-10-12-16(22(26)28-2)24-20(14)18/h3-12H,1-2H3

Standard InChI Key:  RPTOOJSTBPXQMY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   18.0470   -4.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0458   -5.5452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7539   -5.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7521   -4.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4607   -4.7220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4614   -5.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1700   -5.9481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8782   -5.5373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8735   -4.7152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1644   -4.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7557   -6.7713    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.0490   -7.1816    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.0509   -7.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0514   -9.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7605   -9.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7555   -8.3994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3423   -9.2213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3414   -8.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6382   -8.0047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9353   -8.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9402   -9.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6440   -9.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5875   -5.9431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5907   -6.7603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2936   -5.5318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0029   -5.9376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2260   -8.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2227   -7.1896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5199   -8.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8106   -8.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 18  2  0
 17 14  2  0
 14 15  1  0
 15 16  2  0
 16 13  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  8 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 20 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4085742

    ---

Associated Targets(Human)

PSMD14 Tchem 26S proteasome non-ATPase regulatory subunit 14 (475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.51Molecular Weight (Monoisotopic): 436.0551AlogP: 5.16#Rotatable Bonds: 5
Polar Surface Area: 78.38Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.80CX LogP: 5.27CX LogD: 5.27
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -0.41

References

1. Perez C, Li J, Parlati F, Rouffet M, Ma Y, Mackinnon AL, Chou TF, Deshaies RJ, Cohen SM..  (2017)  Discovery of an Inhibitor of the Proteasome Subunit Rpn11.,  60  (4): [PMID:28191850] [10.1021/acs.jmedchem.6b01379]

Source