N-(1-Amino(cyclopropyl)methylene)-3-(4-chlorophenyl)-N'-((4-chlorophenyl)sulfonyl)-4-phenyl-4,5-dihydro-1H-pyrazole-1-carboximidamide

ID: ALA4085754

PubChem CID: 137643124

Max Phase: Preclinical

Molecular Formula: C26H23Cl2N5O2S

Molecular Weight: 540.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N/C(=N/C(=N\S(=O)(=O)c1ccc(Cl)cc1)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1)C1CC1

Standard InChI:  InChI=1S/C26H23Cl2N5O2S/c27-20-10-8-18(9-11-20)24-23(17-4-2-1-3-5-17)16-33(31-24)26(30-25(29)19-6-7-19)32-36(34,35)22-14-12-21(28)13-15-22/h1-5,8-15,19,23H,6-7,16H2,(H2,29,30,32)

Standard InChI Key:  YBOYWYPZUYVOHH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   23.8719  -16.4718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0865  -15.6835    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.2965  -15.8918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6226  -13.2178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3026  -13.6710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9450  -13.1658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6608  -12.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8452  -12.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3347  -14.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6435  -14.9236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0579  -14.8681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9203  -14.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2292  -14.9791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.8131  -16.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8422  -16.8809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5645  -17.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2566  -16.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2218  -16.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4990  -15.6278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3411  -11.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6444  -11.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1382  -10.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3287  -10.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0280  -11.2753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5361  -11.9126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1096  -11.7191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9262  -11.7718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3783  -11.0920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0149  -10.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1949  -10.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7465  -10.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8209   -9.8706    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   26.9803  -17.2048    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.5070  -13.8303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5054  -13.0064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7926  -13.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  2  0
  5  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  2  0
 12 13  1  0
 11  2  1  0
  2 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  8 20  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  7 26  1  0
 23 32  1  0
 17 33  1  0
 12 34  1  0
 35 34  1  0
 36 35  1  0
 34 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4085754

    ---

Associated Targets(non-human)

Cnr1 Cannabinoid CB1 receptor (739 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cnr2 Cannabinoid CB2 receptor (862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.48Molecular Weight (Monoisotopic): 539.0950AlogP: 5.31#Rotatable Bonds: 5
Polar Surface Area: 100.48Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.66CX LogP: 5.28CX LogD: 4.83
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.86

References

1. Iyer MR, Cinar R, Katz A, Gao M, Erdelyi K, Jourdan T, Coffey NJ, Pacher P, Kunos G..  (2017)  Design, Synthesis, and Biological Evaluation of Novel, Non-Brain-Penetrant, Hybrid Cannabinoid CB1R Inverse Agonist/Inducible Nitric Oxide Synthase (iNOS) Inhibitors for the Treatment of Liver Fibrosis.,  60  (3): [PMID:28085283] [10.1021/acs.jmedchem.6b01504]

Source