5-fluoro-3-((1S,2S)-2-phenylcyclopropanecarboxamido)-1H-indole-2-carboxylic acid

ID: ALA4085766

PubChem CID: 7395803

Max Phase: Preclinical

Molecular Formula: C19H15FN2O3

Molecular Weight: 338.34

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1[nH]c2ccc(F)cc2c1NC(=O)[C@H]1C[C@@H]1c1ccccc1

Standard InChI:  InChI=1S/C19H15FN2O3/c20-11-6-7-15-14(8-11)16(17(21-15)19(24)25)22-18(23)13-9-12(13)10-4-2-1-3-5-10/h1-8,12-13,21H,9H2,(H,22,23)(H,24,25)/t12-,13+/m1/s1

Standard InChI Key:  LBCNHUJFDVBZDB-OLZOCXBDSA-N

Molfile:  

     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
    3.9109   -4.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4978   -5.0815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1360   -5.0760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7249   -4.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7258   -5.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9091   -5.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6422   -6.5702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3130   -7.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9774   -6.5716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3081   -7.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6091   -8.2792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0151   -8.2838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7613   -6.8287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3763   -6.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1523   -6.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2097   -5.4796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6977   -7.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9522   -6.3648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8663   -7.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2550   -8.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4216   -9.2782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1988   -9.5331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8097   -8.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6383   -8.1897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1314   -3.6638    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  1  0
 10 12  2  0
  8 10  1  0
  9 13  1  0
 13 14  1  0
 15 14  1  1
 14 16  2  0
 17 15  1  0
 18 17  1  0
 15 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 19  1  6
  4 25  1  0
M  END

Associated Targets(Human)

CFD Tchem Complement factor D (1353 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 338.34Molecular Weight (Monoisotopic): 338.1067AlogP: 3.75#Rotatable Bonds: 4
Polar Surface Area: 82.19Molecular Species: ACIDHBA: 2HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.83CX Basic pKa: CX LogP: 3.88CX LogD: 0.63
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.68Np Likeness Score: -1.07

References

1. Vulpetti A, Randl S, Rüdisser S, Ostermann N, Erbel P, Mac Sweeney A, Zoller T, Salem B, Gerhartz B, Cumin F, Hommel U, Dalvit C, Lorthiois E, Maibaum J..  (2017)  Structure-Based Library Design and Fragment Screening for the Identification of Reversible Complement Factor D Protease Inhibitors.,  60  (5): [PMID:28157311] [10.1021/acs.jmedchem.6b01684]

Source