The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-fluoro-3-((1S,2S)-2-phenylcyclopropanecarboxamido)-1H-indole-2-carboxylic acid ID: ALA4085766
PubChem CID: 7395803
Max Phase: Preclinical
Molecular Formula: C19H15FN2O3
Molecular Weight: 338.34
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1[nH]c2ccc(F)cc2c1NC(=O)[C@H]1C[C@@H]1c1ccccc1
Standard InChI: InChI=1S/C19H15FN2O3/c20-11-6-7-15-14(8-11)16(17(21-15)19(24)25)22-18(23)13-9-12(13)10-4-2-1-3-5-10/h1-8,12-13,21H,9H2,(H,22,23)(H,24,25)/t12-,13+/m1/s1
Standard InChI Key: LBCNHUJFDVBZDB-OLZOCXBDSA-N
Molfile:
RDKit 2D
25 28 0 0 0 0 0 0 0 0999 V2000
3.9109 -4.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4978 -5.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1360 -5.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7249 -4.3699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7258 -5.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9091 -5.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6422 -6.5702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3130 -7.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9774 -6.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3081 -7.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6091 -8.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0151 -8.2838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7613 -6.8287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3763 -6.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1523 -6.5334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2097 -5.4796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6977 -7.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9522 -6.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8663 -7.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2550 -8.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4216 -9.2782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1988 -9.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8097 -8.9847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6383 -8.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1314 -3.6638 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 6 1 0
5 3 1 0
3 4 2 0
4 1 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 1 0
10 12 2 0
8 10 1 0
9 13 1 0
13 14 1 0
15 14 1 1
14 16 2 0
17 15 1 0
18 17 1 0
15 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 19 1 6
4 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 338.34Molecular Weight (Monoisotopic): 338.1067AlogP: 3.75#Rotatable Bonds: 4Polar Surface Area: 82.19Molecular Species: ACIDHBA: 2HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.83CX Basic pKa: ┄CX LogP: 3.88CX LogD: 0.63Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.68Np Likeness Score: -1.07
References 1. Vulpetti A, Randl S, Rüdisser S, Ostermann N, Erbel P, Mac Sweeney A, Zoller T, Salem B, Gerhartz B, Cumin F, Hommel U, Dalvit C, Lorthiois E, Maibaum J.. (2017) Structure-Based Library Design and Fragment Screening for the Identification of Reversible Complement Factor D Protease Inhibitors., 60 (5): [PMID:28157311 ] [10.1021/acs.jmedchem.6b01684 ]