(S)-3-(2-Adamantan-2-yl-ethyl)-4-benzyl-1-[4-((S)-2-propyl-4,5-dihydro-1H-imidazol-4-yl)-butyl]-imidazolidine-2-thione

ID: ALA4085975

PubChem CID: 137641972

Max Phase: Preclinical

Molecular Formula: C32H48N4S

Molecular Weight: 520.83

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCC1=N[C@@H](CCCCN2C[C@H](Cc3ccccc3)N(CCC3C4CC5CC(C4)CC3C5)C2=S)CN1

Standard InChI:  InChI=1S/C32H48N4S/c1-2-8-31-33-21-28(34-31)11-6-7-13-35-22-29(20-23-9-4-3-5-10-23)36(32(35)37)14-12-30-26-16-24-15-25(18-26)19-27(30)17-24/h3-5,9-10,24-30H,2,6-8,11-22H2,1H3,(H,33,34)/t24?,25?,26?,27?,28-,29-,30?/m0/s1

Standard InChI Key:  YWXKEURVSUMZSF-VTEGQJLWSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    7.9149  -21.9323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7465  -21.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9698  -20.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8015  -20.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0248  -19.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7751  -19.0477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9579  -19.0461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7039  -19.8229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3641  -20.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3631  -21.1215    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.4789  -18.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8746  -17.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6887  -17.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0843  -16.9439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6628  -16.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8416  -16.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4497  -16.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9262  -20.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3199  -19.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6916  -22.1864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9439  -22.9592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7611  -22.9608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0152  -22.1840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3549  -21.7025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7928  -21.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5423  -19.7771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4012  -21.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7523  -20.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2132  -20.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0429  -19.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8915  -19.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3736  -20.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7424  -19.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9650  -20.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0814  -19.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9642  -21.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7419  -20.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
  7 11  1  1
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  8 18  1  0
 18 19  1  0
 20  1  1  6
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 20  1  0
 23 25  1  0
 19 26  1  0
 27 28  1  0
 27 29  1  0
 28 30  1  0
 29 26  1  0
 30 31  1  0
 26 31  1  0
 32 33  1  0
 29 32  1  0
 28 34  1  0
 31 35  1  0
 35 33  1  0
 33 34  1  0
 25 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4085975

    ---

Associated Targets(Human)

RORA Tchem Nuclear receptor ROR-alpha (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rorc Nuclear receptor ROR-gamma (89407 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rorb Nuclear receptor ROR-beta (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.83Molecular Weight (Monoisotopic): 520.3600AlogP: 6.30#Rotatable Bonds: 12
Polar Surface Area: 30.87Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.47CX LogP: 6.45CX LogD: 4.12
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -0.05

References

1. Nefzi A, Marconi GD, Ortiz MA, Davis JC, Piedrafita FJ..  (2017)  Synthesis of dihydroimidazole tethered imidazolinethiones and their activity as novel antagonists of the nuclear retinoic acid receptor-related orphan receptors (RORs).,  27  (7): [PMID:28242276] [10.1016/j.bmcl.2017.02.014]

Source