The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,4,5-Trimethoxy-N-(6-methyl-3-(phenylthio)pyrido[2,3-b]pyrazin-7-yl)benzamide ID: ALA4086049
PubChem CID: 137644784
Max Phase: Preclinical
Molecular Formula: C24H22N4O4S
Molecular Weight: 462.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)Nc2cc3ncc(Sc4ccccc4)nc3nc2C)cc(OC)c1OC
Standard InChI: InChI=1S/C24H22N4O4S/c1-14-17(27-24(29)15-10-19(30-2)22(32-4)20(11-15)31-3)12-18-23(26-14)28-21(13-25-18)33-16-8-6-5-7-9-16/h5-13H,1-4H3,(H,27,29)
Standard InChI Key: QCSCIRRTWXHGJL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
26.0590 -13.9651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7687 -13.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7659 -12.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0573 -12.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3510 -13.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3533 -12.7384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6473 -12.3293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9387 -12.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9403 -13.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6469 -13.9631 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4771 -13.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4720 -12.3217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2336 -13.9680 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
22.5229 -13.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5264 -12.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8185 -12.3626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1108 -12.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1154 -13.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8238 -13.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1813 -12.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8875 -12.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1844 -13.5448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5951 -12.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3008 -12.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2982 -11.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5839 -11.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8812 -11.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5780 -10.2742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2827 -9.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0038 -11.0849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7136 -11.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0098 -12.7214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0125 -13.5386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
2 11 1 0
3 12 1 0
9 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
12 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
26 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
24 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.53Molecular Weight (Monoisotopic): 462.1362AlogP: 4.76#Rotatable Bonds: 7Polar Surface Area: 95.46Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.78CX LogP: 3.94CX LogD: 3.94Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.42Np Likeness Score: -0.98
References 1. Argyros O, Lougiakis N, Kouvari E, Papafotika A, Raptopoulou CP, Psycharis V, Christoforidis S, Pouli N, Marakos P, Tamvakopoulos C.. (2017) Design and synthesis of novel 7-aminosubstituted pyrido[2,3-b]pyrazines exhibiting anti-breast cancer activity., 126 [PMID:28006668 ] [10.1016/j.ejmech.2016.12.025 ]