(trans)-N-(3-(7-(3-Acrylamido-4-methylphenylamino)-1-methyl-2-oxo-1,2-dihydropyrimido[4,5-d]pyrimidin-3(4H)-yl)-4-methylphenyl)-4-butylcyclohexanecarboxamide

ID: ALA4086091

PubChem CID: 137642885

Max Phase: Preclinical

Molecular Formula: C35H43N7O3

Molecular Weight: 609.77

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CC(=O)Nc1cc(Nc2ncc3c(n2)N(C)C(=O)N(c2cc(NC(=O)[C@H]4CC[C@H](CCCC)CC4)ccc2C)C3)ccc1C

Standard InChI:  InChI=1S/C35H43N7O3/c1-6-8-9-24-12-14-25(15-13-24)33(44)37-28-17-11-23(4)30(19-28)42-21-26-20-36-34(40-32(26)41(5)35(42)45)38-27-16-10-22(3)29(18-27)39-31(43)7-2/h7,10-11,16-20,24-25H,2,6,8-9,12-15,21H2,1,3-5H3,(H,37,44)(H,39,43)(H,36,38,40)/t24-,25-

Standard InChI Key:  OVRPQNZBOGVQNI-SOAUALDESA-N

Molfile:  

     RDKit          2D

 45 49  0  0  0  0  0  0  0  0999 V2000
   16.5126  -16.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5115  -17.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2283  -17.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9466  -17.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9437  -16.2862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2264  -15.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7962  -15.8746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7948  -17.5294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6635  -17.5282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3792  -17.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0921  -17.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3779  -16.2894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0825  -17.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0790  -18.7652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7997  -18.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3672  -18.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3758  -17.5230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6671  -17.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9492  -17.5105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9445  -18.3378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6539  -18.7539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0755  -19.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5163  -18.7674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2260  -18.7493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2216  -19.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5002  -19.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4954  -20.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2101  -21.2249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9310  -20.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9322  -19.9846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2068  -22.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6466  -21.2257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3638  -20.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0752  -21.2283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3653  -19.9851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0650  -22.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0893  -18.3465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7981  -18.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5121  -18.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5128  -17.5243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7995  -17.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2234  -18.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9365  -18.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6478  -18.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3609  -18.3540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  2  8  1  0
  4  9  1  0
  9 10  1  0
 11 10  1  1
 10 12  2  0
  8 13  1  0
  8 15  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 22  1  0
 15 23  2  0
 20 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 29 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  2  0
 11 37  1  0
 11 41  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 39 42  1  6
 42 43  1  0
 43 44  1  0
 44 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4086091

    ---

Associated Targets(Human)

BMX Tchem Tyrosine-protein kinase BMX (1995 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

BaF3 (4657 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 609.77Molecular Weight (Monoisotopic): 609.3427AlogP: 7.47#Rotatable Bonds: 10
Polar Surface Area: 119.56Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.08CX Basic pKa: 1.69CX LogP: 7.38CX LogD: 7.38
Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.21Np Likeness Score: -1.16

References

1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J..  (2017)  Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor.,  60  (5): [PMID:28140585] [10.1021/acs.jmedchem.6b01413]

Source