2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl 3,5-dimethoxybenzoate

ID: ALA4086122

Cas Number: 941010-49-7

PubChem CID: 16645447

Max Phase: Preclinical

Molecular Formula: C15H17N3O6

Molecular Weight: 335.32

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(OC)cc(C(=O)OCCn2c([N+](=O)[O-])cnc2C)c1

Standard InChI:  InChI=1S/C15H17N3O6/c1-10-16-9-14(18(20)21)17(10)4-5-24-15(19)11-6-12(22-2)8-13(7-11)23-3/h6-9H,4-5H2,1-3H3

Standard InChI Key:  QRFXPTOQJWCHTI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   19.0213   -2.0885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6758   -1.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4144   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5947   -0.8356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3558   -1.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0314   -2.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4582   -1.8417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0586   -1.2874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6381   -2.6389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7441   -3.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7542   -4.1225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4670   -4.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4771   -5.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1696   -4.1050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5823   -1.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7737   -5.7518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7835   -6.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4968   -6.9688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2017   -6.5471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1884   -5.7321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0807   -6.9852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3682   -6.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9158   -6.9443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6169   -6.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  2  7  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  5 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 13  1  0
 17 21  1  0
 21 22  1  0
 19 23  1  0
 23 24  1  0
M  CHG  2   7   1   9  -1
M  END

Associated Targets(non-human)

GUSB Beta-glucuronidase (291 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 335.32Molecular Weight (Monoisotopic): 335.1117AlogP: 1.97#Rotatable Bonds: 7
Polar Surface Area: 105.72Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.27CX LogP: 1.72CX LogD: 1.72
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.43Np Likeness Score: -1.22

References

1. Salar U, Khan KM, Taha M, Ismail NH, Ali B, Qurat-Ul-Ain, Perveen S, Ghufran M, Wadood A..  (2017)  Biology-oriented drug synthesis (BIODS): In vitro β-glucuronidase inhibitory and in silico studies on 2-(2-methyl-5-nitro-1H-imidazol-1-yl)ethyl aryl carboxylate derivatives.,  125  [PMID:27886546] [10.1016/j.ejmech.2016.11.031]

Source