The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
sodium-(5S,8S)-5-Isobutyl-12-methyl-3,6,11-trioxo-8-(((S)-2-oxopyrrolidin-3-yl)methyl)-1-phenyl-2,10-dioxa-4,7-diazatridecane-9-sulfonate ID: ALA4086271
PubChem CID: 137643352
Max Phase: Preclinical
Molecular Formula: C25H36N3NaO9S
Molecular Weight: 555.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(OC(=O)C(C)C)S(=O)(=O)[O-].[Na+]
Standard InChI: InChI=1S/C25H37N3O9S.Na/c1-15(2)12-19(28-25(32)36-14-17-8-6-5-7-9-17)22(30)27-20(13-18-10-11-26-21(18)29)24(38(33,34)35)37-23(31)16(3)4;/h5-9,15-16,18-20,24H,10-14H2,1-4H3,(H,26,29)(H,27,30)(H,28,32)(H,33,34,35);/q;+1/p-1/t18-,19-,20-,24?;/m0./s1
Standard InChI Key: FNZKOKGWFWWIQZ-IMYFVKEDSA-M
Molfile:
RDKit 2D
40 40 0 0 0 0 0 0 0 0999 V2000
22.1613 -16.3003 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
21.3634 -16.7817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9546 -16.0674 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.5432 -16.7777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3872 -16.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3855 -16.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0991 -17.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8151 -16.9297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8150 -16.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1005 -15.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5256 -15.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2410 -16.0914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9559 -15.6765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6693 -16.0907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9512 -14.8547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3776 -15.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0930 -16.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3728 -14.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0877 -14.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0830 -13.6049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8031 -14.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0977 -16.9003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8107 -15.6716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5300 -16.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2449 -15.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5348 -16.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2502 -17.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3410 -18.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1509 -18.3067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5559 -17.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0055 -16.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7308 -18.6820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2402 -14.8388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9551 -14.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9504 -13.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6752 -15.6566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6705 -14.8348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4607 -17.5516 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.6597 -13.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2364 -13.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
16 18 1 1
18 19 1 0
19 20 1 0
19 21 1 0
17 22 2 0
17 23 1 0
23 24 1 0
24 25 1 0
24 26 1 6
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
27 31 1 0
28 32 2 0
25 3 1 0
25 33 1 0
33 34 1 0
34 35 1 0
3 36 1 0
34 37 2 0
27 38 1 1
35 39 1 0
35 40 1 0
M CHG 2 1 1 36 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.65Molecular Weight (Monoisotopic): 555.2251AlogP: 1.75#Rotatable Bonds: 13Polar Surface Area: 177.20Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: -0.83CX Basic pKa: ┄CX LogP: 1.20CX LogD: -0.16Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: 0.30
References 1. Galasiti Kankanamalage AC, Kim Y, Rathnayake AD, Alliston KR, Butler MM, Cardinale SC, Bowlin TL, Groutas WC, Chang KO.. (2017) Design, Synthesis, and Evaluation of Novel Prodrugs of Transition State Inhibitors of Norovirus 3CL Protease., 60 (14): [PMID:28671827 ] [10.1021/acs.jmedchem.7b00497 ]