The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-fluoro-3-(isoquinolin-4-ylethynyl)-N-(4-((4-methylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)benzamide ID: ALA4086643
PubChem CID: 86567604
Max Phase: Preclinical
Molecular Formula: C31H26F4N4O
Molecular Weight: 546.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(Cc2ccc(NC(=O)c3ccc(F)c(C#Cc4cncc5ccccc45)c3)cc2C(F)(F)F)CC1
Standard InChI: InChI=1S/C31H26F4N4O/c1-38-12-14-39(15-13-38)20-25-8-10-26(17-28(25)31(33,34)35)37-30(40)22-9-11-29(32)21(16-22)6-7-24-19-36-18-23-4-2-3-5-27(23)24/h2-5,8-11,16-19H,12-15,20H2,1H3,(H,37,40)
Standard InChI Key: IWAIRGHIYWNQTE-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
11.7029 -7.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9992 -7.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2889 -7.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5852 -7.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5919 -8.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3022 -9.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0058 -8.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6962 -6.6091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4173 -7.8255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1210 -7.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1143 -6.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8180 -6.1808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5283 -6.5842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5349 -7.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8313 -7.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2320 -6.1663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9423 -6.5697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9489 -7.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6633 -7.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3670 -7.3764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3604 -6.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6459 -6.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0773 -7.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8749 -7.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1605 -7.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0296 -5.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7333 -5.4239 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4436 -5.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4502 -6.6444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7465 -7.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7532 -7.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0495 -8.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3392 -7.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3326 -7.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0362 -6.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8882 -9.0854 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.8095 -5.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8039 -4.6175 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.4674 -4.8165 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.1435 -4.8265 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 22 1 0
20 23 1 0
16 17 1 0
13 16 1 0
9 10 1 0
24 25 3 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
26 35 1 0
30 35 2 0
25 29 1 0
4 24 1 0
5 36 1 0
37 38 1 0
37 39 1 0
37 40 1 0
12 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.57Molecular Weight (Monoisotopic): 546.2043AlogP: 5.79#Rotatable Bonds: 4Polar Surface Area: 48.47Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.62CX LogP: 5.77CX LogD: 5.34Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.26Np Likeness Score: -1.52
References 1. Liu Y, Peng X, Guan X, Lu D, Xi Y, Jin S, Chen H, Zeng L, Ai J, Geng M, Hu Y.. (2017) Discovery of novel Ponatinib analogues for reducing KDR activity as potent FGFRs inhibitors., 126 [PMID:27750146 ] [10.1016/j.ejmech.2016.10.003 ]