4-cyano-2-ethoxy-N-(7-methoxy-1,3-dimethyl-2-oxo-1,2-dihydroquinolin-6-yl)benzenesulfonamide

ID: ALA4086654

PubChem CID: 118918750

Max Phase: Preclinical

Molecular Formula: C21H21N3O5S

Molecular Weight: 427.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1cc(C#N)ccc1S(=O)(=O)Nc1cc2cc(C)c(=O)n(C)c2cc1OC

Standard InChI:  InChI=1S/C21H21N3O5S/c1-5-29-19-9-14(12-22)6-7-20(19)30(26,27)23-16-10-15-8-13(2)21(25)24(3)17(15)11-18(16)28-4/h6-11,23H,5H2,1-4H3

Standard InChI Key:  LPVPWCQDKRDPCW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    5.8442  -16.2406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4397  -15.5349    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0307  -16.2380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1537  -15.1222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8663  -15.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8651  -16.3585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5773  -16.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5755  -15.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2883  -15.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2871  -16.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9974  -16.7651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7093  -16.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7105  -15.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9998  -15.1155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4200  -16.7686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9952  -17.5864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7307  -15.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7301  -14.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0293  -13.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3169  -14.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3139  -15.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0192  -15.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1576  -16.7674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4201  -15.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1580  -17.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6117  -13.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9066  -13.4724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0157  -16.3519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3062  -16.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3027  -17.5746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 12 15  2  0
 11 16  1  0
  5  4  1  0
  4  2  1  0
  2 17  1  0
 17 18  1  0
 17 22  2  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
  6 23  1  0
 13 24  1  0
 23 25  1  0
 20 26  1  0
 26 27  3  0
 22 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4086654

    ---

Associated Targets(Human)

BRPF1 Tchem Peregrin (2217 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 427.48Molecular Weight (Monoisotopic): 427.1202AlogP: 2.93#Rotatable Bonds: 6
Polar Surface Area: 110.42Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.37CX Basic pKa: CX LogP: 2.24CX LogD: 1.52
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.59

References

1. Igoe N, Bayle ED, Tallant C, Fedorov O, Meier JC, Savitsky P, Rogers C, Morias Y, Scholze S, Boyd H, Cunoosamy D, Andrews DM, Cheasty A, Brennan PE, Müller S, Knapp S, Fish PV..  (2017)  Design of a Chemical Probe for the Bromodomain and Plant Homeodomain Finger-Containing (BRPF) Family of Proteins.,  60  (16): [PMID:28714688] [10.1021/acs.jmedchem.7b00611]

Source