The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dimethyl 2,2'-((8,8'-Disulfanediylbis(quinoline-8,3-diyl-3-carbonyl))bis(azanediyl))diacetate ID: ALA4086748
PubChem CID: 137644814
Max Phase: Preclinical
Molecular Formula: C26H22N4O6S2
Molecular Weight: 550.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CNC(=O)c1cnc2c(SSc3cccc4cc(C(=O)NCC(=O)OC)cnc34)cccc2c1
Standard InChI: InChI=1S/C26H22N4O6S2/c1-35-21(31)13-29-25(33)17-9-15-5-3-7-19(23(15)27-11-17)37-38-20-8-4-6-16-10-18(12-28-24(16)20)26(34)30-14-22(32)36-2/h3-12H,13-14H2,1-2H3,(H,29,33)(H,30,34)
Standard InChI Key: KWDAVAFOLMHSLD-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
23.9324 -13.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9312 -14.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6393 -15.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6375 -13.5659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3461 -13.9712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3469 -14.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0554 -15.1972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7637 -14.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7589 -13.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0498 -13.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6412 -16.0204 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.9344 -16.4307 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.9363 -17.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9369 -18.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6460 -18.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6409 -17.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2277 -18.4704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2268 -17.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5236 -17.2538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8208 -17.6616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8256 -18.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5294 -18.8777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4641 -13.5514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1743 -13.9557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4592 -12.7342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1205 -18.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4102 -18.4863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1256 -19.7076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8795 -13.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5897 -13.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2949 -13.5342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5947 -14.7642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0051 -13.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7051 -18.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9948 -18.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2897 -18.9082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9897 -17.6780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5794 -18.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 11 1 0
11 12 1 0
12 13 1 0
13 18 2 0
17 14 2 0
14 15 1 0
15 16 2 0
16 13 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
23 25 2 0
21 26 1 0
26 27 1 0
26 28 2 0
24 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 33 1 0
27 34 1 0
34 35 1 0
35 36 1 0
35 37 2 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.62Molecular Weight (Monoisotopic): 550.0981AlogP: 3.39#Rotatable Bonds: 9Polar Surface Area: 136.58Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.73CX Basic pKa: 2.17CX LogP: 2.29CX LogD: 2.29Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.24Np Likeness Score: -0.62
References 1. Perez C, Li J, Parlati F, Rouffet M, Ma Y, Mackinnon AL, Chou TF, Deshaies RJ, Cohen SM.. (2017) Discovery of an Inhibitor of the Proteasome Subunit Rpn11., 60 (4): [PMID:28191850 ] [10.1021/acs.jmedchem.6b01379 ]