The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(trans)-N-(3-(7-(3-Acrylamido-4-methylphenylamino)-1-methyl-2-oxo-1,2-dihydropyrimido[4,5-d]pyrimidin-3(4H)-yl)-4-methylphenyl)-4-isopropylcyclohexanecarboxamide ID: ALA4086774
PubChem CID: 137641775
Max Phase: Preclinical
Molecular Formula: C34H41N7O3
Molecular Weight: 595.75
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2ncc3c(n2)N(C)C(=O)N(c2cc(NC(=O)[C@H]4CC[C@H](C(C)C)CC4)ccc2C)C3)ccc1C
Standard InChI: InChI=1S/C34H41N7O3/c1-7-30(42)38-28-16-26(14-8-21(28)4)37-33-35-18-25-19-41(34(44)40(6)31(25)39-33)29-17-27(15-9-22(29)5)36-32(43)24-12-10-23(11-13-24)20(2)3/h7-9,14-18,20,23-24H,1,10-13,19H2,2-6H3,(H,36,43)(H,38,42)(H,35,37,39)/t23-,24-
Standard InChI Key: BMTSNXMAAOHQMW-RQNOJGIXSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
28.9938 -9.0503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9926 -9.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7093 -10.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4277 -9.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4249 -9.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7075 -8.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2773 -8.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2760 -10.2899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1447 -10.2888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8604 -9.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5732 -10.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8591 -9.0499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5636 -9.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5601 -11.5258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2808 -11.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8484 -11.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8569 -10.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1482 -9.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4303 -10.2710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4256 -11.0983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1350 -11.5144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5567 -12.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9973 -11.5279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7071 -11.5099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7026 -12.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9813 -12.7397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9766 -13.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6912 -13.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4121 -13.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4133 -12.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6878 -14.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1277 -13.9862 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8449 -13.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5563 -13.9888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8464 -12.7457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5461 -14.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5705 -11.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2793 -11.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9932 -11.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9939 -10.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2806 -9.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7045 -11.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4176 -11.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7027 -12.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
4 9 1 0
9 10 1 0
11 10 1 1
10 12 2 0
8 13 1 0
8 15 1 0
13 17 1 0
16 14 1 0
14 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 1 0
15 23 2 0
20 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
29 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
11 37 1 0
11 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
39 42 1 6
42 43 1 0
42 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.75Molecular Weight (Monoisotopic): 595.3271AlogP: 6.94#Rotatable Bonds: 8Polar Surface Area: 119.56Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.08CX Basic pKa: 1.69CX LogP: 6.78CX LogD: 6.78Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.24Np Likeness Score: -1.17
References 1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J.. (2017) Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor., 60 (5): [PMID:28140585 ] [10.1021/acs.jmedchem.6b01413 ]