(E)-3-(4-((benzyl(quinolin-2-ylmethyl)amino)methyl)phenyl)-N-hydroxyacrylamide

ID: ALA4086866

PubChem CID: 137641543

Max Phase: Preclinical

Molecular Formula: C27H25N3O2

Molecular Weight: 423.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc(CN(Cc2ccccc2)Cc2ccc3ccccc3n2)cc1)NO

Standard InChI:  InChI=1S/C27H25N3O2/c31-27(29-32)17-14-21-10-12-23(13-11-21)19-30(18-22-6-2-1-3-7-22)20-25-16-15-24-8-4-5-9-26(24)28-25/h1-17,32H,18-20H2,(H,29,31)/b17-14+

Standard InChI Key:  JLJGNKOSNNKSNV-SAPNQHFASA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   25.3769   -5.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3758   -6.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0838   -7.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0820   -5.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7906   -5.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7914   -6.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4999   -7.1863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2082   -6.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2035   -5.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4944   -5.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9175   -7.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6236   -6.7700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3329   -7.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0390   -6.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7432   -7.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4489   -6.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4461   -5.9444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7319   -5.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0291   -5.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1517   -5.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8615   -5.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5671   -5.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2769   -5.9297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5628   -4.7076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2812   -6.7469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6170   -7.5858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3214   -8.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3134   -8.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0169   -9.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7289   -8.8281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7329   -8.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0288   -7.5962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 12 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4086866

    ---

Associated Targets(Human)

HDAC1 Tclin Histone deacetylase (HDAC1 and HDAC2) (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.52Molecular Weight (Monoisotopic): 423.1947AlogP: 4.96#Rotatable Bonds: 8
Polar Surface Area: 65.46Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.56CX Basic pKa: 7.73CX LogP: 4.83CX LogD: 4.45
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.24Np Likeness Score: -0.62

References

1. Chen C, Hou X, Wang G, Pan W, Yang X, Zhang Y, Fang H..  (2017)  Design, synthesis and biological evaluation of quinoline derivatives as HDAC class I inhibitors.,  133  [PMID:28371677] [10.1016/j.ejmech.2017.03.064]

Source