The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(4-((benzyl(quinolin-2-ylmethyl)amino)methyl)phenyl)-N-hydroxyacrylamide ID: ALA4086866
PubChem CID: 137641543
Max Phase: Preclinical
Molecular Formula: C27H25N3O2
Molecular Weight: 423.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(/C=C/c1ccc(CN(Cc2ccccc2)Cc2ccc3ccccc3n2)cc1)NO
Standard InChI: InChI=1S/C27H25N3O2/c31-27(29-32)17-14-21-10-12-23(13-11-21)19-30(18-22-6-2-1-3-7-22)20-25-16-15-24-8-4-5-9-26(24)28-25/h1-17,32H,18-20H2,(H,29,31)/b17-14+
Standard InChI Key: JLJGNKOSNNKSNV-SAPNQHFASA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
25.3769 -5.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3758 -6.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0838 -7.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0820 -5.5549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7906 -5.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7914 -6.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4999 -7.1863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2082 -6.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2035 -5.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4944 -5.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9175 -7.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6236 -6.7700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3329 -7.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0390 -6.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7432 -7.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4489 -6.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4461 -5.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7319 -5.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0291 -5.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1517 -5.5322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8615 -5.9371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5671 -5.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2769 -5.9297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.5628 -4.7076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2812 -6.7469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6170 -7.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3214 -8.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3134 -8.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0169 -9.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7289 -8.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7329 -8.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0288 -7.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
12 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.52Molecular Weight (Monoisotopic): 423.1947AlogP: 4.96#Rotatable Bonds: 8Polar Surface Area: 65.46Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.56CX Basic pKa: 7.73CX LogP: 4.83CX LogD: 4.45Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.24Np Likeness Score: -0.62
References 1. Chen C, Hou X, Wang G, Pan W, Yang X, Zhang Y, Fang H.. (2017) Design, synthesis and biological evaluation of quinoline derivatives as HDAC class I inhibitors., 133 [PMID:28371677 ] [10.1016/j.ejmech.2017.03.064 ]