The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-methoxyphenyl)-2-(4-methylphenylsulfonamido)-6-((4-nitrophenyl)sulfonyl)benzamide ID: ALA4087114
PubChem CID: 71811672
Max Phase: Preclinical
Molecular Formula: C27H23N3O8S2
Molecular Weight: 581.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1NC(=O)c1c(NS(=O)(=O)c2ccc(C)cc2)cccc1S(=O)(=O)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C27H23N3O8S2/c1-18-10-14-21(15-11-18)40(36,37)29-23-7-5-9-25(39(34,35)20-16-12-19(13-17-20)30(32)33)26(23)27(31)28-22-6-3-4-8-24(22)38-2/h3-17,29H,1-2H3,(H,28,31)
Standard InChI Key: QHEVDMPSKXIHJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
18.9811 -8.9602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2754 -9.3729 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.9857 -9.7778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4358 -6.9090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1457 -6.5045 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.4405 -6.0920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2785 -7.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5634 -8.1377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5638 -8.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8570 -9.3613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1498 -8.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1495 -8.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8563 -7.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9856 -8.1338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2781 -6.9018 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2671 -10.1992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9784 -10.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9788 -11.4312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2678 -11.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5648 -11.4310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5645 -10.6098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2682 -12.6548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9795 -13.0655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5614 -13.0653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9849 -6.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9846 -5.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6872 -5.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3985 -5.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3989 -6.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6879 -6.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2692 -5.2510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8563 -6.9098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2777 -4.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1452 -5.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8532 -5.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8505 -4.4612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1407 -4.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4322 -4.4701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4384 -5.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1365 -3.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
8 13 2 0
7 14 2 0
7 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
22 23 2 0
22 24 1 0
19 22 1 0
2 16 1 0
9 2 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
25 30 2 0
26 31 1 0
15 25 1 0
13 32 1 0
31 33 1 0
32 5 1 0
5 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
37 40 1 0
M CHG 2 22 1 24 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.63Molecular Weight (Monoisotopic): 581.0927AlogP: 4.80#Rotatable Bonds: 9Polar Surface Area: 161.78Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.12CX Basic pKa: ┄CX LogP: 4.80CX LogD: 4.42Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.57
References 1. Zhou M, Luo RH, Hou XY, Wang RR, Yan GY, Chen H, Zhang RH, Shi JY, Zheng YT, Li R, Wei YQ.. (2017) Synthesis, biological evaluation and molecular docking study of N-(2-methoxyphenyl)-6-((4-nitrophenyl)sulfonyl)benzamide derivatives as potent HIV-1 Vif antagonists., 129 [PMID:28235704 ] [10.1016/j.ejmech.2017.01.010 ]