The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(7-(3-Acrylamido-4-methylphenylamino)-1-methyl-2-oxo-1,2-dihydropyrimido[4,5-d]pyrimidin-3(4H)-yl)-4-methylphenyl)-4-methoxybenzamide ID: ALA4087169
PubChem CID: 137643616
Max Phase: Preclinical
Molecular Formula: C32H31N7O4
Molecular Weight: 577.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2ncc3c(n2)N(C)C(=O)N(c2cc(NC(=O)c4ccc(OC)cc4)ccc2C)C3)ccc1C
Standard InChI: InChI=1S/C32H31N7O4/c1-6-28(40)36-26-15-23(11-7-19(26)2)35-31-33-17-22-18-39(32(42)38(4)29(22)37-31)27-16-24(12-8-20(27)3)34-30(41)21-9-13-25(43-5)14-10-21/h6-17H,1,18H2,2-5H3,(H,34,41)(H,36,40)(H,33,35,37)
Standard InChI Key: HUXNTBKQZJDQER-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
46.0536 -2.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0536 -1.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3445 -1.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3445 -0.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0536 0.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7626 -0.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7626 -1.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7626 -2.6595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.3445 -2.6595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.0536 1.0305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.7626 1.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6354 -2.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9264 -2.6595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2173 -2.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2173 -1.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9264 -1.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6354 -1.4314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5082 -1.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5082 -3.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7992 -3.8876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.0901 -3.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0901 -2.6595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7992 -2.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5082 -2.6595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6720 -3.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3811 -3.8876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.3811 -2.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6720 -2.6595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.2173 -3.8876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.7992 -4.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9629 -3.8876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2539 -3.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5448 -3.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8357 -3.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8357 -2.6595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5448 -2.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2539 -2.6595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1267 -2.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1204 -4.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8253 -5.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5384 -4.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4072 -5.1019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1285 -3.8809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
10 11 1 0
5 10 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
15 18 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
19 24 1 0
25 26 1 0
27 28 1 0
25 28 2 0
21 26 2 0
22 27 2 0
19 29 2 0
20 30 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
32 37 2 0
35 38 1 0
39 40 1 0
40 41 2 0
39 42 2 0
39 43 1 0
34 43 1 0
31 32 1 0
25 31 1 0
14 24 1 0
9 12 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.65Molecular Weight (Monoisotopic): 577.2438AlogP: 5.80#Rotatable Bonds: 8Polar Surface Area: 128.79Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 13.12CX Basic pKa: 1.69CX LogP: 5.34CX LogD: 5.34Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.23Np Likeness Score: -1.25
References 1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J.. (2017) Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor., 60 (5): [PMID:28140585 ] [10.1021/acs.jmedchem.6b01413 ]