4-Methyl-2-oxo-2H-chromene-7,8-diyl bis(2,5-dichlorobenzenesulfonate)

ID: ALA4087225

PubChem CID: 137642465

Max Phase: Preclinical

Molecular Formula: C22H12Cl4O8S2

Molecular Weight: 610.28

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2c(OS(=O)(=O)c3cc(Cl)ccc3Cl)c(OS(=O)(=O)c3cc(Cl)ccc3Cl)ccc12

Standard InChI:  InChI=1S/C22H12Cl4O8S2/c1-11-8-20(27)32-21-14(11)4-7-17(33-35(28,29)18-9-12(23)2-5-15(18)25)22(21)34-36(30,31)19-10-13(24)3-6-16(19)26/h2-10H,1H3

Standard InChI Key:  XTKWMTSRBFEQAT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    5.5759  -11.0362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3931  -11.0403    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.9881  -10.3306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5647   -8.6961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9774   -9.4060    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.3859   -8.6936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3958   -8.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3946   -9.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1027   -9.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1009   -8.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8095   -8.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8129   -9.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5213   -9.8109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2310   -9.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2276   -8.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5146   -8.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5101   -7.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9398   -9.8066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6866   -9.8163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2712   -9.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5644   -9.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8587   -9.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8595  -10.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5720  -11.0385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2748  -10.6276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1032  -10.6344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3963  -11.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6897  -12.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6899  -13.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3984  -13.4925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1082  -13.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1045  -12.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5645   -8.5888    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.5761  -11.8557    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.9823  -11.8580    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.8176  -13.4846    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 14 18  2  0
  8 19  1  0
 19  5  1  0
  5 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  9 26  1  0
 26  2  1  0
  2 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 21 33  1  0
 24 34  1  0
 28 35  1  0
 31 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4087225

    ---

Associated Targets(Human)

ALPL Tchem Alkaline phosphatase, tissue-nonspecific isozyme (1551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALPI Tchem Intestinal alkaline phosphatase (724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 610.28Molecular Weight (Monoisotopic): 607.8728AlogP: 6.25#Rotatable Bonds: 6
Polar Surface Area: 116.95Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.93CX LogD: 6.93
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.19Np Likeness Score: -0.52

References

1. Salar U, Khan KM, Iqbal J, Ejaz SA, Hameed A, Al-Rashida M, Perveen S, Tahir MN..  (2017)  Coumarin sulfonates: New alkaline phosphatase inhibitors; in vitro and in silico studies.,  131  [PMID:28288318] [10.1016/j.ejmech.2017.03.003]

Source