The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Celaspermin E; 1alpha,6beta,8alpha-Triacetoxy-9alpha-benzoyloxy-2-oxo-beta-dihydroagarofuran ID: ALA4087336
PubChem CID: 132526812
Max Phase: Preclinical
Molecular Formula: C28H34O10
Molecular Weight: 530.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@@H]1[C@@H]2[C@@H](OC(C)=O)[C@]3(OC2(C)C)[C@H](C)CC(=O)[C@H](OC(C)=O)[C@@]3(C)[C@@H]1OC(=O)c1ccccc1
Standard InChI: InChI=1S/C28H34O10/c1-14-13-19(32)22(35-16(3)30)27(7)24(37-25(33)18-11-9-8-10-12-18)21(34-15(2)29)20-23(36-17(4)31)28(14,27)38-26(20,5)6/h8-12,14,20-24H,13H2,1-7H3/t14-,20-,21-,22+,23-,24-,27+,28-/m1/s1
Standard InChI Key: KVQJNLUVMJNRON-XBHLUESWSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
28.4536 -6.9428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6760 -6.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8856 -7.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8949 -5.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8949 -5.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5920 -6.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5920 -4.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2851 -5.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2867 -5.9326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9823 -6.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6792 -5.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6776 -5.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9792 -4.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5920 -3.9123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1964 -4.7224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8912 -3.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8912 -2.7030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1945 -3.9123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2781 -4.3189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9759 -3.9137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6751 -3.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3734 -3.9080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6718 -2.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3712 -2.3013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3685 -1.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6693 -1.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9707 -1.5005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9746 -2.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3783 -4.7203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0752 -5.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7758 -4.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0755 -5.9293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5917 -7.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2844 -6.7353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9760 -7.1356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7623 -7.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3330 -8.4868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9819 -8.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4583 -6.1389 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 7 1 0
5 6 1 0
6 9 1 0
8 7 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
7 14 1 6
4 15 2 0
14 16 1 0
16 17 2 0
16 18 1 0
8 19 1 6
13 20 1 6
20 21 1 0
21 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
12 29 1 6
29 30 1 0
30 31 1 0
30 32 2 0
6 33 1 6
9 34 1 1
11 2 1 0
34 2 1 0
10 35 1 1
35 36 1 0
36 37 2 0
36 38 1 0
11 39 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.57Molecular Weight (Monoisotopic): 530.2152AlogP: 2.80#Rotatable Bonds: 5Polar Surface Area: 131.50Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.81CX LogD: 2.81Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.41Np Likeness Score: 2.14
References 1. Gao L, Zhang R, Lan J, Ning R, Wu D, Chen D, Zhao W.. (2016) β-Dihydroagarofuran-Type Sesquiterpenes from the Seeds of Celastrus monospermus and Their Lifespan-Extending Effects on the Nematode Caenorhabditis elegans., 79 (12): [PMID:28006915 ] [10.1021/acs.jnatprod.6b00648 ]