Celaspermin E; 1alpha,6beta,8alpha-Triacetoxy-9alpha-benzoyloxy-2-oxo-beta-dihydroagarofuran

ID: ALA4087336

PubChem CID: 132526812

Max Phase: Preclinical

Molecular Formula: C28H34O10

Molecular Weight: 530.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@@H]1[C@@H]2[C@@H](OC(C)=O)[C@]3(OC2(C)C)[C@H](C)CC(=O)[C@H](OC(C)=O)[C@@]3(C)[C@@H]1OC(=O)c1ccccc1

Standard InChI:  InChI=1S/C28H34O10/c1-14-13-19(32)22(35-16(3)30)27(7)24(37-25(33)18-11-9-8-10-12-18)21(34-15(2)29)20-23(36-17(4)31)28(14,27)38-26(20,5)6/h8-12,14,20-24H,13H2,1-7H3/t14-,20-,21-,22+,23-,24-,27+,28-/m1/s1

Standard InChI Key:  KVQJNLUVMJNRON-XBHLUESWSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   28.4536   -6.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6760   -6.7353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8856   -7.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8949   -5.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8949   -5.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5920   -6.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5920   -4.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2851   -5.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2867   -5.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9823   -6.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6792   -5.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6776   -5.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9792   -4.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5920   -3.9123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1964   -4.7224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8912   -3.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8912   -2.7030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1945   -3.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2781   -4.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9759   -3.9137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6751   -3.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3734   -3.9080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6718   -2.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3712   -2.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3685   -1.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6693   -1.0906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9707   -1.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9746   -2.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3783   -4.7203    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0752   -5.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7758   -4.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0755   -5.9293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5917   -7.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2844   -6.7353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9760   -7.1356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7623   -7.9132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3330   -8.4868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9819   -8.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4583   -6.1389    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  7  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  7 14  1  6
  4 15  2  0
 14 16  1  0
 16 17  2  0
 16 18  1  0
  8 19  1  6
 13 20  1  6
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 12 29  1  6
 29 30  1  0
 30 31  1  0
 30 32  2  0
  6 33  1  6
  9 34  1  1
 11  2  1  0
 34  2  1  0
 10 35  1  1
 35 36  1  0
 36 37  2  0
 36 38  1  0
 11 39  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4087336

    ---

Associated Targets(non-human)

Caenorhabditis elegans (1055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.57Molecular Weight (Monoisotopic): 530.2152AlogP: 2.80#Rotatable Bonds: 5
Polar Surface Area: 131.50Molecular Species: NEUTRALHBA: 10HBD:
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 2.81CX LogD: 2.81
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.41Np Likeness Score: 2.14

References

1. Gao L, Zhang R, Lan J, Ning R, Wu D, Chen D, Zhao W..  (2016)  β-Dihydroagarofuran-Type Sesquiterpenes from the Seeds of Celastrus monospermus and Their Lifespan-Extending Effects on the Nematode Caenorhabditis elegans.,  79  (12): [PMID:28006915] [10.1021/acs.jnatprod.6b00648]

Source