tetraisopropyl 2-(naphthalen-1-yl)ethene-1,1-diyldiphosphonate

ID: ALA4087503

PubChem CID: 130466228

Max Phase: Preclinical

Molecular Formula: C24H36O6P2

Molecular Weight: 482.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)OP(=O)(OC(C)C)C(=Cc1cccc2ccccc12)P(=O)(OC(C)C)OC(C)C

Standard InChI:  InChI=1S/C24H36O6P2/c1-17(2)27-31(25,28-18(3)4)24(32(26,29-19(5)6)30-20(7)8)16-22-14-11-13-21-12-9-10-15-23(21)22/h9-20H,1-8H3

Standard InChI Key:  GNDIJSPIMKLMGF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
   12.0789  -11.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7933  -10.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0789  -12.1497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0768  -13.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7936  -13.3810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7904  -12.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5079  -11.3248    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   12.7933  -10.0873    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   12.5748   -9.2832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5486   -9.6406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9915  -10.2956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5079  -12.1497    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1747  -10.6373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2997  -11.5331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7771   -9.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5607   -8.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1958   -9.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5394   -8.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2946   -8.3165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7750   -8.3325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1035  -10.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7704  -10.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3654  -11.7924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5168  -12.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3146  -12.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9361  -12.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3618  -13.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3645  -12.5645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6568  -12.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9458  -12.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9470  -13.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6553  -13.7924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3 28  2  0
 27  4  2  0
  4  5  1  0
  5  6  2  0
  6  3  1  0
  2  7  1  0
  2  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  2  0
  7 12  2  0
  7 13  1  0
  7 14  1  0
  9 15  1  0
 15 16  1  0
 15 17  1  0
 10 18  1  0
 18 19  1  0
 18 20  1  0
 13 21  1  0
 21 22  1  0
 21 23  1  0
 14 24  1  0
 24 25  1  0
 24 26  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4087503

    ---

Associated Targets(Human)

LS180 (140 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.49Molecular Weight (Monoisotopic): 482.1987AlogP: 8.22#Rotatable Bonds: 11
Polar Surface Area: 71.06Molecular Species: HBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.50CX LogD: 6.50
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: -0.28

References

1.  (2016)  (10): [10.1039/C6MD00300A]

Source