The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4alpha-[2-(4-isobutylphenyl)-propionate]-4-desoxypodophyllotoxin ID: ALA4087564
PubChem CID: 137642707
Max Phase: Preclinical
Molecular Formula: C35H38O9
Molecular Weight: 602.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)C(C)c3ccc(CC(C)C)cc3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC
Standard InChI: InChI=1S/C35H38O9/c1-18(2)11-20-7-9-21(10-8-20)19(3)34(36)44-32-24-15-27-26(42-17-43-27)14-23(24)30(31-25(32)16-41-35(31)37)22-12-28(38-4)33(40-6)29(13-22)39-5/h7-10,12-15,18-19,25,30-32H,11,16-17H2,1-6H3/t19?,25-,30+,31-,32-/m0/s1
Standard InChI Key: DUPJGLIXVQPPPT-UBUFRXMASA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
9.1008 -6.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2219 -9.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8063 -9.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2219 -9.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5121 -10.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8063 -9.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5121 -8.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5121 -11.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9979 -10.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1005 -10.4006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1005 -8.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5121 -12.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4766 -9.5793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9979 -8.9231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8022 -12.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2178 -12.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3907 -9.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3907 -9.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8022 -11.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2178 -11.6305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6147 -10.2438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6147 -8.9231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1360 -9.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2496 -11.0238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5121 -7.9490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5203 -13.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0882 -12.8687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9318 -12.8687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8187 -14.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0923 -13.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6458 -12.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2219 -10.8051 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.2219 -8.3618 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.8085 -7.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1008 -7.9490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8085 -6.7191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5162 -6.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2234 -6.7220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9307 -6.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9311 -5.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2184 -5.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5141 -5.4979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6383 -5.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3465 -5.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0537 -5.0846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3476 -6.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 6 1 0
4 2 1 0
5 4 1 0
6 7 1 0
7 2 1 0
5 8 1 6
9 4 1 0
10 3 2 0
11 6 2 0
12 16 1 0
13 14 1 0
14 2 1 0
15 19 1 0
16 20 2 0
17 11 1 0
18 17 2 0
19 8 2 0
20 8 1 0
21 18 1 0
22 17 1 0
23 22 1 0
24 9 2 0
7 25 1 6
26 12 1 0
27 15 1 0
28 16 1 0
29 26 1 0
30 27 1 0
31 28 1 0
4 32 1 1
2 33 1 6
9 13 1 0
3 5 1 0
18 10 1 0
15 12 2 0
23 21 1 0
25 34 1 0
34 35 2 0
34 36 1 0
36 1 1 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
40 43 1 0
43 44 1 0
44 45 1 0
44 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 602.68Molecular Weight (Monoisotopic): 602.2516AlogP: 5.96#Rotatable Bonds: 9Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.13CX LogD: 6.13Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.27Np Likeness Score: 1.06
References 1. Zhang L, Liu L, Zheng C, Wang Y, Nie X, Shi D, Chen Y, Wei G, Wang J.. (2017) Synthesis and biological evaluation of novel podophyllotoxin-NSAIDs conjugates as multifunctional anti-MDR agents against resistant human hepatocellular carcinoma Bel-7402/5-FU cells., 131 [PMID:28301815 ] [10.1016/j.ejmech.2017.03.011 ]