The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[3-[4-[[5-(3,4-Dimethoxy-N-methyl-anilino)-1-(4-fluorophenyl)-imidazol-2-yl]sulfanylmethyl]-3,5-difluoro-phenoxy]propyl-(2-sulfonatoethyl)amino]ethanesulfonate-diammonium ID: ALA4087611
PubChem CID: 137644372
Max Phase: Preclinical
Molecular Formula: C32H43F3N6O9S3
Molecular Weight: 774.86
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N(C)c2cnc(SCc3c(F)cc(OCCCN(CCS(=O)(=O)O)CCS(=O)(=O)O)cc3F)n2-c2ccc(F)cc2)cc1OC.N.N
Standard InChI: InChI=1S/C32H37F3N4O9S3.2H3N/c1-37(24-9-10-29(46-2)30(17-24)47-3)31-20-36-32(39(31)23-7-5-22(33)6-8-23)49-21-26-27(34)18-25(19-28(26)35)48-14-4-11-38(12-15-50(40,41)42)13-16-51(43,44)45;;/h5-10,17-20H,4,11-16,21H2,1-3H3,(H,40,41,42)(H,43,44,45);2*1H3
Standard InChI Key: JZNRCJHCZVFOEX-UHFFFAOYSA-N
Molfile:
RDKit 2D
53 54 0 0 0 0 0 0 0 0999 V2000
21.3637 -13.5279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4062 -12.8481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8190 -13.5579 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.2274 -12.8456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6361 -11.1064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8190 -11.1064 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.2275 -11.8141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1105 -13.9696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4014 -13.5610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4014 -12.7438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1105 -12.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1105 -11.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6964 -12.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9873 -12.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2782 -12.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5733 -12.7438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8642 -12.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8642 -11.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1551 -11.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4501 -11.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4501 -12.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1551 -12.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7410 -12.7438 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.1551 -10.2923 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.7410 -11.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0319 -11.5180 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.3270 -11.1095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2388 -10.2949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4404 -10.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0318 -10.8332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5797 -11.4397 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4089 -12.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6317 -12.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4610 -13.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0674 -13.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8488 -13.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0154 -12.7901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9008 -14.6374 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.2214 -10.9173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7064 -10.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9974 -9.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4823 -8.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6763 -9.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3852 -9.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8962 -10.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9263 -11.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1612 -8.3808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3551 -8.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7775 -8.1255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2624 -7.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8202 -10.2923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5269 -13.9702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2358 -10.4412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
6 5 2 0
7 6 2 0
8 9 1 0
8 3 1 0
11 12 1 0
12 6 1 0
10 11 1 0
13 14 1 0
14 15 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
16 17 1 0
21 23 1 0
19 24 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
27 31 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
32 37 2 0
35 38 1 0
31 32 1 0
39 40 1 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
40 45 2 0
39 46 1 0
47 48 1 0
43 47 1 0
49 50 1 0
42 49 1 0
30 39 1 0
26 27 1 0
25 26 1 0
20 25 1 0
15 16 1 0
10 13 1 0
9 10 1 0
6 51 1 0
3 52 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 774.86Molecular Weight (Monoisotopic): 774.1675AlogP: 5.21#Rotatable Bonds: 19Polar Surface Area: 160.73Molecular Species: ACIDHBA: 12HBD: 2#RO5 Violations: 3HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: -1.92CX Basic pKa: 8.09CX LogP: -2.46CX LogD: 0.57Aromatic Rings: 4Heavy Atoms: 51QED Weighted: 0.07Np Likeness Score: -1.12
References 1. Lasalle M, Hoguet V, Hennuyer N, Leroux F, Piveteau C, Belloy L, Lestavel S, Vallez E, Dorchies E, Duplan I, Sevin E, Culot M, Gosselet F, Boulahjar R, Herledan A, Staels B, Deprez B, Tailleux A, Charton J.. (2017) Topical Intestinal Aminoimidazole Agonists of G-Protein-Coupled Bile Acid Receptor 1 Promote Glucagon Like Peptide-1 Secretion and Improve Glucose Tolerance., 60 (10): [PMID:28414465 ] [10.1021/acs.jmedchem.6b01873 ]