The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(1-(3-amino-4-chloroisoxazolo[5,4-c]pyridin-7-yl)pyrrolidin-3-yl)-4-(1H-benzo[d]imidazol-1-yl)-2-chlorobenzamide ID: ALA4087720
PubChem CID: 118456946
Max Phase: Preclinical
Molecular Formula: C24H19Cl2N7O2
Molecular Weight: 508.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Nc1noc2c(N3CC[C@@H](NC(=O)c4ccc(-n5cnc6ccccc65)cc4Cl)C3)ncc(Cl)c12
Standard InChI: InChI=1S/C24H19Cl2N7O2/c25-16-9-14(33-12-29-18-3-1-2-4-19(18)33)5-6-15(16)24(34)30-13-7-8-32(11-13)23-21-20(17(26)10-28-23)22(27)31-35-21/h1-6,9-10,12-13H,7-8,11H2,(H2,27,31)(H,30,34)/t13-/m1/s1
Standard InChI Key: ABEOONNPOGQYDK-CYBMUJFWSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
20.7874 -4.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7863 -5.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4943 -5.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2040 -5.2641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2012 -4.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4925 -4.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0796 -4.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0794 -3.2194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3720 -4.4453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6642 -4.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5782 -3.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7788 -3.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3704 -3.7634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9174 -4.3705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5597 -3.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0796 -3.1881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2676 -3.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9347 -4.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2301 -4.5949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4164 -4.6874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2529 -5.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9656 -5.8935 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5695 -5.3403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5092 -5.8286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.4901 -3.2189 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.1219 -4.1049 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.9083 -5.6696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9951 -6.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7947 -6.6508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6543 -5.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1995 -5.9434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9960 -5.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2485 -4.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6983 -4.3915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9038 -4.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 2 0
7 9 1 0
10 9 1 1
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 20 1 0
19 15 1 0
13 15 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
21 24 1 0
6 25 1 0
18 26 1 0
27 28 1 0
28 29 2 0
29 31 1 0
30 27 1 0
4 27 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.37Molecular Weight (Monoisotopic): 507.0977AlogP: 4.46#Rotatable Bonds: 4Polar Surface Area: 115.10Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.90CX LogP: 3.81CX LogD: 3.81Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -1.82
References 1. Sakurada I, Endo T, Hikita K, Hirabayashi T, Hosaka Y, Kato Y, Maeda Y, Matsumoto S, Mizuno T, Nagasue H, Nishimura T, Shimada S, Shinozaki M, Taguchi K, Takeuchi K, Yokoyama T, Hruza A, Reichert P, Zhang T, Wood HB, Nakao K, Furusako S.. (2017) Discovery of novel aminobenzisoxazole derivatives as orally available factor IXa inhibitors., 27 (11): [PMID:28408226 ] [10.1016/j.bmcl.2017.03.002 ]