8,8'-Disulfanediylbis(N-(thiophen-2-ylmethyl)quinoline-4-carboxamide)

ID: ALA4087722

PubChem CID: 126599622

Max Phase: Preclinical

Molecular Formula: C30H22N4O2S4

Molecular Weight: 598.80

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCc1cccs1)c1ccnc2c(SSc3cccc4c(C(=O)NCc5cccs5)ccnc34)cccc12

Standard InChI:  InChI=1S/C30H22N4O2S4/c35-29(33-17-19-5-3-15-37-19)23-11-13-31-27-21(23)7-1-9-25(27)39-40-26-10-2-8-22-24(12-14-32-28(22)26)30(36)34-18-20-6-4-16-38-20/h1-16H,17-18H2,(H,33,35)(H,34,36)

Standard InChI Key:  ANEKDCBJYOLYPY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   28.4558   -5.6171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4547   -6.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1627   -6.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1609   -5.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8696   -5.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8703   -6.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5789   -6.8396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2871   -6.4288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2824   -5.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5733   -5.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1646   -7.6628    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.4579   -8.0730    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   28.4597   -8.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4603  -10.5206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1694  -10.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1644   -9.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7511  -10.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7503   -9.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0470   -8.8961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3442   -9.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3490  -10.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0528  -10.5200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5689   -4.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2745   -3.9738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.8591   -3.9813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.2701   -3.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9757   -2.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7235   -3.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2671   -2.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8547   -1.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0564   -1.9264    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.0573  -11.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3518  -11.7497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7672  -11.7419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.3563  -12.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6508  -12.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9012  -12.6543    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   24.3577  -13.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7701  -13.9701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5685  -13.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
 11 12  1  0
 12 13  1  0
 13 18  2  0
 17 14  2  0
 14 15  1  0
 15 16  2  0
 16 13  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 10 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  1  0
 22 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4087722

    ---

Associated Targets(Human)

PSMD14 Tchem 26S proteasome non-ATPase regulatory subunit 14 (475 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 598.80Molecular Weight (Monoisotopic): 598.0626AlogP: 7.57#Rotatable Bonds: 9
Polar Surface Area: 83.98Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 2.01CX LogP: 6.31CX LogD: 6.31
Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: -1.05

References

1. Perez C, Li J, Parlati F, Rouffet M, Ma Y, Mackinnon AL, Chou TF, Deshaies RJ, Cohen SM..  (2017)  Discovery of an Inhibitor of the Proteasome Subunit Rpn11.,  60  (4): [PMID:28191850] [10.1021/acs.jmedchem.6b01379]

Source