The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-tert-Butyl-4-{[5-(2-{[(4-fluoro-3-methoxyphenyl)methyl]-carbamoyl}eth-1-yn-1-yl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl]methyl}benzamide ID: ALA4087742
PubChem CID: 137642719
Max Phase: Preclinical
Molecular Formula: C27H27FN4O5
Molecular Weight: 506.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CNC(=O)C#Cc2cn(Cc3ccc(C(=O)NC(C)(C)C)cc3)c(=O)[nH]c2=O)ccc1F
Standard InChI: InChI=1S/C27H27FN4O5/c1-27(2,3)31-25(35)19-8-5-17(6-9-19)15-32-16-20(24(34)30-26(32)36)10-12-23(33)29-14-18-7-11-21(28)22(13-18)37-4/h5-9,11,13,16H,14-15H2,1-4H3,(H,29,33)(H,31,35)(H,30,34,36)
Standard InChI Key: HRGCMNWOMJOGDZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
37.0677 -13.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0677 -14.5393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.7798 -14.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4815 -14.5393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4815 -13.7160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7798 -13.3012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1923 -14.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9027 -15.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3542 -13.3064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.1950 -13.3064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6167 -15.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6133 -16.5920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3260 -15.3653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.0400 -15.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7534 -15.3713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4588 -15.7857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1673 -15.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1746 -14.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4602 -14.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7520 -14.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4625 -13.3278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3640 -14.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6528 -14.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6539 -13.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9481 -13.3205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2388 -13.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2420 -14.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9528 -14.9553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5303 -13.3227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5288 -12.5055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.1713 -12.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8846 -14.1549 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.8234 -13.7326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1149 -13.3253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1133 -12.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4080 -13.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4041 -12.9141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
4 7 1 0
7 8 3 0
1 9 2 0
5 10 2 0
8 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
2 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 2 0
21 31 1 0
18 32 1 0
29 33 1 0
33 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.53Molecular Weight (Monoisotopic): 506.1965AlogP: 1.93#Rotatable Bonds: 6Polar Surface Area: 122.29Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.49CX Basic pKa: ┄CX LogP: 2.41CX LogD: 2.40Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -1.16
References 1. Senn N, Ott M, Lanz J, Riedl R.. (2017) Targeted Polypharmacology: Discovery of a Highly Potent Non-Hydroxamate Dual Matrix Metalloproteinase (MMP)-10/-13 Inhibitor., 60 (23): [PMID:28953404 ] [10.1021/acs.jmedchem.7b01001 ]