1,-(4-((3R,4R)-3-((3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(methylamino)tetrahydro-2H-pyran-2-yloxy)-4-formyl-4-hydroxy-5-methyltetrahydrofuran-2-yloxy)-2,5,6-trihydroxycyclohexane-1,3-diyl)diguanidine

ID: ALA4087771

PubChem CID: 137643646

Max Phase: Preclinical

Molecular Formula: C21H39N7O12

Molecular Weight: 581.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN[C@H]1C(O[C@H]2C(OC3C(O)C(O)C(NC(=N)N)C(O)C3NC(=N)N)OC(C)[C@]2(O)C=O)O[C@H](CO)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C21H39N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/t5?,6-,7?,8?,9-,10-,11?,12?,13-,14?,15?,16+,17?,18?,21-/m1/s1

Standard InChI Key:  UCSJYZPVAKXKNQ-WPFINQCMSA-N

Molfile:  

     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
   13.2763   -6.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9317   -7.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3405   -8.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0747   -8.7624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0099   -7.9265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7619   -8.2669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7800   -9.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9429   -9.8185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7278  -10.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8906  -10.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2729  -11.4350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4359  -12.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6714  -11.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8343  -11.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2890  -10.6080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0739  -10.8711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1261   -9.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7439   -9.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5809   -8.4442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3455   -9.5344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0323   -8.6677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3132   -9.0723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6017   -8.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8828   -9.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8751   -9.8856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1561  -10.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1487  -11.1156    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4488   -9.8695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1712   -8.6396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4565   -9.0442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1830   -7.8142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4716   -7.3976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4791   -6.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7718   -6.1515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1980   -6.1676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9020   -7.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9096   -6.5842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6093   -7.8304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3283   -7.4258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1256   -7.8501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  1
  3  5  1  0
  5  6  2  0
  3  7  1  0
  7  8  1  1
  8  9  1  0
  9 10  1  0
 10 11  1  1
 11 12  1  0
 10 13  1  0
 13 14  1  6
 13 15  1  0
 15 16  1  1
 15 17  1  0
 17 18  1  6
 18 19  1  0
 17 20  1  0
  9 20  1  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 24 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 31 36  1  0
 36 37  1  0
 36 38  1  0
 23 38  1  0
 38 39  1  0
 21 40  1  0
  2 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4087771

    ---

Associated Targets(Human)

ABCB11 Tchem Bile salt export pump (2311 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 581.58Molecular Weight (Monoisotopic): 581.2657AlogP: -7.74#Rotatable Bonds: 9
Polar Surface Area: 331.43Molecular Species: BASEHBA: 15HBD: 14
#RO5 Violations: 3HBA (Lipinski): 19HBD (Lipinski): 16#RO5 Violations (Lipinski): 3
CX Acidic pKa: 10.88CX Basic pKa: 11.48CX LogP: -7.49CX LogD: -12.13
Aromatic Rings: Heavy Atoms: 40QED Weighted: 0.07Np Likeness Score: 1.69

References

1. Warner DJ, Chen H, Cantin LD, Kenna JG, Stahl S, Walker CL, Noeske T..  (2012)  Mitigating the inhibition of human bile salt export pump by drugs: opportunities provided by physicochemical property modulation, in silico modeling, and structural modification.,  40  (12): [PMID:22961681] [10.1124/dmd.112.047068]

Source