The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(3-(hydroxyamino)-3-oxoprop-1-en-1-yl)-N-((8-methoxyquinolin-2-yl)methyl)-N-phenylbenzamide ID: ALA4087984
PubChem CID: 137645100
Max Phase: Preclinical
Molecular Formula: C27H23N3O4
Molecular Weight: 453.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc2ccc(CN(C(=O)c3ccc(/C=C/C(=O)NO)cc3)c3ccccc3)nc12
Standard InChI: InChI=1S/C27H23N3O4/c1-34-24-9-5-6-20-15-16-22(28-26(20)24)18-30(23-7-3-2-4-8-23)27(32)21-13-10-19(11-14-21)12-17-25(31)29-33/h2-17,33H,18H2,1H3,(H,29,31)/b17-12+
Standard InChI Key: XQZKZVIFDHWYMG-SFQUDFHCSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
36.2439 -20.8548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2428 -21.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9508 -22.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9490 -20.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6576 -20.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6584 -21.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3669 -22.0773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.0752 -21.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0705 -20.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3613 -20.4410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7845 -22.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4906 -21.6610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1999 -22.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9060 -21.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6102 -22.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3158 -21.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3131 -20.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5988 -20.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8961 -20.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0187 -20.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7285 -20.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.4341 -20.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1439 -20.8207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.4298 -19.5986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.1482 -21.6379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4840 -20.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1918 -20.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1856 -19.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4729 -19.2073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7650 -19.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7748 -20.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2031 -22.8840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9527 -22.9005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2459 -23.3108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
12 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
13 32 2 0
3 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.50Molecular Weight (Monoisotopic): 453.1689AlogP: 4.61#Rotatable Bonds: 7Polar Surface Area: 91.76Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.56CX Basic pKa: 1.91CX LogP: 4.09CX LogD: 4.08Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: -0.96
References 1. Chen C, Hou X, Wang G, Pan W, Yang X, Zhang Y, Fang H.. (2017) Design, synthesis and biological evaluation of quinoline derivatives as HDAC class I inhibitors., 133 [PMID:28371677 ] [10.1016/j.ejmech.2017.03.064 ]