The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(7-((3-Acrylamido-4-methylphenyl)amino)-1-methyl-2-oxo-1,2-dihydropyrimido[4,5-d]pyrimidin-3(4H)-yl)-4-methylphenyl)-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxamide ID: ALA4088068
PubChem CID: 137644872
Max Phase: Preclinical
Molecular Formula: C33H31N7O5
Molecular Weight: 605.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2ncc3c(n2)N(C)C(=O)N(c2cc(NC(=O)c4ccc5c(c4)OCCO5)ccc2C)C3)ccc1C
Standard InChI: InChI=1S/C33H31N7O5/c1-5-29(41)37-25-15-23(9-6-19(25)2)36-32-34-17-22-18-40(33(43)39(4)30(22)38-32)26-16-24(10-7-20(26)3)35-31(42)21-8-11-27-28(14-21)45-13-12-44-27/h5-11,14-17H,1,12-13,18H2,2-4H3,(H,35,42)(H,37,41)(H,34,36,38)
Standard InChI Key: XDMQCUFOFSCUBC-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
28.7849 -15.4235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7838 -16.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4993 -16.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2162 -16.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2134 -15.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4975 -15.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0698 -15.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0684 -16.6608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9320 -16.6597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6465 -16.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3581 -16.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6451 -15.4231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3547 -17.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0696 -17.8945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0656 -16.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3573 -16.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3538 -17.8945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0733 -17.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6433 -17.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6519 -16.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9444 -16.2396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2277 -16.6421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2231 -17.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9312 -17.8832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3503 -18.7195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7885 -17.8967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5058 -17.8786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5014 -18.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7813 -19.1063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7765 -19.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4900 -20.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2097 -19.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2109 -19.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4867 -21.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9240 -20.3506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6398 -19.9373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3500 -20.3532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6413 -19.1122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3398 -21.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7780 -16.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7881 -17.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5075 -17.8794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2213 -17.4582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2112 -16.6288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4872 -16.2206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
4 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
11 13 2 0
13 14 1 0
14 41 2 0
40 15 2 0
15 11 1 0
8 16 1 0
8 18 1 0
16 20 1 0
19 17 1 0
17 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
18 26 2 0
23 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
32 35 1 0
35 36 1 0
36 37 1 0
36 38 2 0
37 39 2 0
40 41 1 0
40 45 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 605.66Molecular Weight (Monoisotopic): 605.2387AlogP: 5.56#Rotatable Bonds: 7Polar Surface Area: 138.02Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 13.11CX Basic pKa: 1.69CX LogP: 5.01CX LogD: 5.01Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.23Np Likeness Score: -1.28
References 1. Liang X, Lv F, Wang B, Yu K, Wu H, Qi Z, Jiang Z, Chen C, Wang A, Miao W, Wang W, Hu Z, Liu J, Liu X, Zhao Z, Wang L, Zhang S, Ye Z, Wang C, Ren T, Wang Y, Liu Q, Liu J.. (2017) Discovery of 2-((3-Acrylamido-4-methylphenyl)amino)-N-(2-methyl-5-(3,4,5-trimethoxybenzamido)phenyl)-4-(methylamino)pyrimidine-5-carboxamide (CHMFL-BMX-078) as a Highly Potent and Selective Type II Irreversible Bone Marrow Kinase in the X Chromosome (BMX) Kinase Inhibitor., 60 (5): [PMID:28140585 ] [10.1021/acs.jmedchem.6b01413 ]