The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6-Methyl-3-(phenylthio)pyrido[2,3-b]pyrazin-7-yl)-N'-(3-chloro-4-fluorophenyl)urea ID: ALA4088145
PubChem CID: 137644637
Max Phase: Preclinical
Molecular Formula: C21H15ClFN5OS
Molecular Weight: 439.90
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc2nc(Sc3ccccc3)cnc2cc1NC(=O)Nc1ccc(F)c(Cl)c1
Standard InChI: InChI=1S/C21H15ClFN5OS/c1-12-17(27-21(29)26-13-7-8-16(23)15(22)9-13)10-18-20(25-12)28-19(11-24-18)30-14-5-3-2-4-6-14/h2-11H,1H3,(H2,26,27,29)
Standard InChI Key: ASEOQHHXKMUBPY-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
4.6747 -13.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6736 -14.2247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3816 -14.6337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3798 -12.9963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0885 -13.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0892 -14.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7978 -14.6277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5060 -14.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5013 -13.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7922 -12.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9656 -14.6328 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2582 -14.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2634 -13.4065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5568 -12.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8478 -13.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8498 -14.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5569 -14.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2153 -14.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2065 -12.9818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9167 -13.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6219 -12.9732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9216 -14.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3321 -13.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3327 -14.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0420 -14.5988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7482 -14.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7406 -13.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0307 -12.9640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4443 -12.9491 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.4589 -14.5892 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
8 18 1 0
9 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
27 29 1 0
26 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.90Molecular Weight (Monoisotopic): 439.0670AlogP: 5.92#Rotatable Bonds: 4Polar Surface Area: 79.80Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.33CX Basic pKa: 1.78CX LogP: 5.21CX LogD: 5.21Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -1.99
References 1. Argyros O, Lougiakis N, Kouvari E, Papafotika A, Raptopoulou CP, Psycharis V, Christoforidis S, Pouli N, Marakos P, Tamvakopoulos C.. (2017) Design and synthesis of novel 7-aminosubstituted pyrido[2,3-b]pyrazines exhibiting anti-breast cancer activity., 126 [PMID:28006668 ] [10.1016/j.ejmech.2016.12.025 ]