2-fluoro-N-methyl-4-(3-oxo-7-(quinolin-7-ylmethyl)-3,4-dihydroimidazo[1,2-b][1,2,4]triazin-2-yl)benzamide

ID: ALA4088155

PubChem CID: 137641599

Max Phase: Preclinical

Molecular Formula: C23H17FN6O2

Molecular Weight: 428.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)c1ccc(-c2nn3c(Cc4ccc5cccnc5c4)cnc3[nH]c2=O)cc1F

Standard InChI:  InChI=1S/C23H17FN6O2/c1-25-21(31)17-7-6-15(11-18(17)24)20-22(32)28-23-27-12-16(30(23)29-20)9-13-4-5-14-3-2-8-26-19(14)10-13/h2-8,10-12H,9H2,1H3,(H,25,31)(H,27,28,32)

Standard InChI Key:  CMGOMYYVKKYNAO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   31.1559  -10.6985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2374   -8.7754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.3457   -9.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5881   -9.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0323   -8.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5463  -10.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9922   -9.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1965   -9.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9537  -10.5178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5128  -11.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3065  -10.9358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9157  -11.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9387  -12.8013    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4092  -12.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1578  -12.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1495  -11.7450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4435  -11.3469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.7411  -11.7593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7494  -12.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4601  -12.9770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.0333  -11.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0274  -10.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3170  -10.1402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6119  -10.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6218  -11.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3328  -11.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9001  -10.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8918   -9.3365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1966  -10.5694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4848  -10.1680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3102   -9.3230    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.0455  -12.9894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  7  2  0
  6  3  2  0
  3  4  1  0
  4  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  9  1  1  0
  1 12  1  0
 12 16  1  0
 15 13  2  0
 13 14  1  0
 14 12  2  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 18 21  1  0
 24 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 23 31  1  0
 19 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4088155

    ---

Associated Targets(Human)

AOX1 Tchem Aldehyde oxidase (429 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.43Molecular Weight (Monoisotopic): 428.1397AlogP: 2.72#Rotatable Bonds: 4
Polar Surface Area: 105.04Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.99CX Basic pKa: 4.33CX LogP: 2.51CX LogD: 2.41
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -1.34

References

1. Xu Y, Li L, Wang Y, Xing J, Zhou L, Zhong D, Luo X, Jiang H, Chen K, Zheng M, Deng P, Chen X..  (2017)  Aldehyde Oxidase Mediated Metabolism in Drug-like Molecules: A Combined Computational and Experimental Study.,  60  (7): [PMID:28263602] [10.1021/acs.jmedchem.7b00019]

Source