The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-((7-Fluoro-6-(4-methylpiperazin-1-yl)-9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3(9H)-ylidene)methyl)phenyl)-2-(pyrrolidin-1-yl)acetamide ID: ALA4088189
PubChem CID: 50902759
Max Phase: Preclinical
Molecular Formula: C29H33FN6O2
Molecular Weight: 516.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2cc3nc4n(c(=O)c3cc2F)CC/C4=C\c2ccc(NC(=O)CN3CCCC3)cc2)CC1
Standard InChI: InChI=1S/C29H33FN6O2/c1-33-12-14-35(15-13-33)26-18-25-23(17-24(26)30)29(38)36-11-8-21(28(36)32-25)16-20-4-6-22(7-5-20)31-27(37)19-34-9-2-3-10-34/h4-7,16-18H,2-3,8-15,19H2,1H3,(H,31,37)/b21-16+
Standard InChI Key: YWLQUHAACJHYEK-LTGZKZEYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
4.6293 -19.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6282 -20.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3362 -20.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3344 -18.9602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9215 -18.9606 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9202 -20.5966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0431 -19.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0419 -20.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7481 -20.5951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7504 -18.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4611 -19.3674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4619 -20.1858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2405 -20.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7209 -19.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2392 -19.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7504 -18.1367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4937 -21.2149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2932 -21.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5452 -22.1616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3438 -22.3310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8910 -21.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6339 -20.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8358 -20.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2165 -20.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5106 -20.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5057 -21.4051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2129 -21.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9250 -21.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7961 -21.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6907 -21.8909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2361 -21.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0358 -21.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9818 -20.5058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5813 -20.8419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3916 -20.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7223 -20.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1137 -19.6285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4070 -20.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 8 2 0
7 4 2 0
4 1 1 0
1 5 1 0
2 6 1 0
7 8 1 0
7 10 1 0
8 9 1 0
9 12 2 0
11 10 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
10 16 2 0
13 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
6 24 1 0
6 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
21 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.62Molecular Weight (Monoisotopic): 516.2649AlogP: 3.27#Rotatable Bonds: 5Polar Surface Area: 73.71Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.52CX Basic pKa: 7.57CX LogP: 2.91CX LogD: 2.46Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.56Np Likeness Score: -1.39
References 1. Shan C, Yan JW, Wang YQ, Che T, Huang ZL, Chen AC, Yao PF, Tan JH, Li D, Ou TM, Gu LQ, Huang ZS.. (2017) Design, Synthesis, and Evaluation of Isaindigotone Derivatives To Downregulate c-myc Transcription via Disrupting the Interaction of NM23-H2 with G-Quadruplex., 60 (4): [PMID:28128954 ] [10.1021/acs.jmedchem.6b01218 ]