Ethyl 6-methyl-4-(3-nitrophenyl)-2-oxo-3-[2-(2-{2-oxoindolin-3-ylidene}hydrazinylcarbonyl)ethyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate

ID: ALA4088201

PubChem CID: 137643438

Max Phase: Preclinical

Molecular Formula: C25H24N6O7

Molecular Weight: 520.50

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(C)NC(=O)N(CCC(=O)N/N=C2/C(=O)Nc3ccccc32)C1c1cccc([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C25H24N6O7/c1-3-38-24(34)20-14(2)26-25(35)30(22(20)15-7-6-8-16(13-15)31(36)37)12-11-19(32)28-29-21-17-9-4-5-10-18(17)27-23(21)33/h4-10,13,22H,3,11-12H2,1-2H3,(H,26,35)(H,28,32)(H,27,29,33)

Standard InChI Key:  DHZXYGXDLNNFCU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   11.4688   -8.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4639   -7.2506    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7497   -6.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0364   -7.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0412   -8.0800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7554   -8.4924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3180   -6.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6046   -7.2635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3173   -6.0217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1772   -6.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8956   -7.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6048   -6.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6040   -6.0046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3231   -7.2377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0365   -6.8252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0598   -7.5044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5030   -6.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7506   -7.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8404   -8.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2910   -8.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5486   -9.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3555   -9.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9050   -9.0059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6474   -8.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6748   -6.0885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1830   -8.4838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7448   -6.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4582   -5.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4574   -4.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7391   -4.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0258   -4.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0306   -5.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1667   -4.3589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1659   -3.5340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8850   -4.7713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3279   -8.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5990   -5.6136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5982   -4.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  4  7  1  0
 10 11  1  0
 12 13  2  0
 14 15  1  0
 12 14  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 16 24  1  0
 19 24  2  0
 17 25  2  0
 15 18  2  0
 11 12  1  0
  2 10  1  0
  1 26  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 27 32  2  0
 33 34  2  0
 33 35  1  0
 29 33  1  0
  3 27  1  0
  5 36  1  0
 37 38  1  0
  9 37  1  0
M  CHG  2  33   1  35  -1
M  END

Alternative Forms

1. Parent:

   

   ALA4088201

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 520.50

Molecular Weight (Monoisotopic): 520.1706

AlogP: 2.36

#Rotatable Bonds: 8

Polar Surface Area: 172.34

Molecular Species: NEUTRAL

HBA: 8

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 13

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 9.92

CX Basic pKa: ┄

CX LogP: 1.72

CX LogD: 1.72

Aromatic Rings: 2

Heavy Atoms: 38

QED Weighted: 0.27

Np Likeness Score: -1.41

References

1. Teleb M, Zhang FX, Huang J, Gadotti VM, Farghaly AM, AboulWafa OM, Zamponi GW, Fahmy H..  (2017)  Synthesis and biological evaluation of novel N3-substituted dihydropyrimidine derivatives as T-type calcium channel blockers and their efficacy as analgesics in mouse models of inflammatory pain.,  25  (6): [PMID:28233679] [10.1016/j.bmc.2017.02.015]

Source

Source(1):

• Scientific Literature