The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Beta-sitosterole ID: ALA4088357
PubChem CID: 137642997
Max Phase: Preclinical
Molecular Formula: C30H52O
Molecular Weight: 428.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@@]2(C)CC=C2C[C@@H](O)CC[C@@]21C)C(C)C
Standard InChI: InChI=1S/C30H52O/c1-8-22(20(2)3)10-9-21(4)25-11-12-26-29(25,6)18-15-27-28(5)17-14-24(31)19-23(28)13-16-30(26,27)7/h13,20-22,24-27,31H,8-12,14-19H2,1-7H3/t21-,22-,24+,25-,26-,27-,28+,29-,30+/m1/s1
Standard InChI Key: SNQGOMFJKZJVJY-CPECYEHCSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
17.4293 -14.1069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1455 -12.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1455 -13.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8575 -14.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8575 -12.4498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5695 -12.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5660 -13.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2747 -14.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9916 -13.6975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2818 -12.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9951 -12.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0121 -11.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2871 -11.6278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7254 -11.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7120 -12.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4939 -12.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9907 -12.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5157 -11.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5621 -12.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7246 -10.5998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5199 -10.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1371 -10.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1073 -10.9598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9027 -10.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4902 -11.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1106 -9.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9059 -9.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2855 -11.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2823 -12.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3079 -11.1831 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.7037 -13.2956 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.2746 -13.2789 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
20.9871 -12.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7204 -10.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 5 1 0
3 4 1 0
4 7 1 0
6 5 1 0
6 7 1 0
6 10 1 0
7 8 2 0
8 9 1 0
9 11 1 0
10 11 1 0
10 13 1 0
11 15 1 0
14 12 1 0
12 13 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
6 19 1 1
18 20 1 0
20 21 1 0
20 22 1 6
21 23 1 0
23 24 1 0
24 25 1 0
24 26 1 1
26 27 1 0
25 28 1 0
25 29 1 0
18 30 1 6
15 31 1 6
10 32 1 6
11 33 1 1
14 34 1 1
3 1 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.75Molecular Weight (Monoisotopic): 428.4018AlogP: 8.41#Rotatable Bonds: 6Polar Surface Area: 20.23Molecular Species: NEUTRALHBA: 1HBD: 1#RO5 Violations: 1HBA (Lipinski): 1HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.14CX LogD: 8.14Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: 2.96
References 1. Romero-Benavides JC, Ruano AL, Silva-Rivas R, Castillo-Veintimilla P, Vivanco-Jaramillo S, Bailon-Moscoso N.. (2017) Medicinal plants used as anthelmintics: Ethnomedical, pharmacological, and phytochemical studies., 129 [PMID:28231520 ] [10.1016/j.ejmech.2017.02.005 ]