Beta-sitosterole

ID: ALA4088357

PubChem CID: 137642997

Max Phase: Preclinical

Molecular Formula: C30H52O

Molecular Weight: 428.75

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@@]2(C)CC=C2C[C@@H](O)CC[C@@]21C)C(C)C

Standard InChI:  InChI=1S/C30H52O/c1-8-22(20(2)3)10-9-21(4)25-11-12-26-29(25,6)18-15-27-28(5)17-14-24(31)19-23(28)13-16-30(26,27)7/h13,20-22,24-27,31H,8-12,14-19H2,1-7H3/t21-,22-,24+,25-,26-,27-,28+,29-,30+/m1/s1

Standard InChI Key:  SNQGOMFJKZJVJY-CPECYEHCSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   17.4293  -14.1069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1455  -12.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1455  -13.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8575  -14.0997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8575  -12.4498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5695  -12.8664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5660  -13.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2747  -14.1046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9916  -13.6975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2818  -12.4546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9951  -12.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0121  -11.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2871  -11.6278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7254  -11.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7120  -12.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4939  -12.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9907  -12.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5157  -11.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5621  -12.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7246  -10.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5199  -10.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1371  -10.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1073  -10.9598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9027  -10.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4902  -11.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1106   -9.9423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9059   -9.7231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2855  -11.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2823  -12.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3079  -11.1831    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.7037  -13.2956    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.2746  -13.2789    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.9871  -12.0497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7204  -10.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  2  5  1  0
  3  4  1  0
  4  7  1  0
  6  5  1  0
  6  7  1  0
  6 10  1  0
  7  8  2  0
  8  9  1  0
  9 11  1  0
 10 11  1  0
 10 13  1  0
 11 15  1  0
 14 12  1  0
 12 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
  6 19  1  1
 18 20  1  0
 20 21  1  0
 20 22  1  6
 21 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  1
 26 27  1  0
 25 28  1  0
 25 29  1  0
 18 30  1  6
 15 31  1  6
 10 32  1  6
 11 33  1  1
 14 34  1  1
  3  1  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4088357

    ---

Associated Targets(non-human)

Brugia malayi (1377 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.75Molecular Weight (Monoisotopic): 428.4018AlogP: 8.41#Rotatable Bonds: 6
Polar Surface Area: 20.23Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 1HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 8.14CX LogD: 8.14
Aromatic Rings: Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: 2.96

References

1. Romero-Benavides JC, Ruano AL, Silva-Rivas R, Castillo-Veintimilla P, Vivanco-Jaramillo S, Bailon-Moscoso N..  (2017)  Medicinal plants used as anthelmintics: Ethnomedical, pharmacological, and phytochemical studies.,  129  [PMID:28231520] [10.1016/j.ejmech.2017.02.005]

Source