4-(((7-(3,4-dimethoxyphenyl)-1-(4-fluorophenyl)-7-methyl-4,5,6,7-tetrahydro-1H-benzo[d]imidazol-2-yl)thio)methyl)-3,5-difluorobenzoic acid

ID: ALA4088541

PubChem CID: 118464718

Max Phase: Preclinical

Molecular Formula: C30H27F3N2O4S

Molecular Weight: 568.62

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1ccc(C2(C)CCCc3nc(SCc4c(F)cc(C(=O)O)cc4F)n(-c4ccc(F)cc4)c32)cc1OC

Standard InChI:  InChI=1S/C30H27F3N2O4S/c1-30(18-6-11-25(38-2)26(15-18)39-3)12-4-5-24-27(30)35(20-9-7-19(31)8-10-20)29(34-24)40-16-21-22(32)13-17(28(36)37)14-23(21)33/h6-11,13-15H,4-5,12,16H2,1-3H3,(H,36,37)

Standard InChI Key:  YQVWEMATYADTSD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   15.4878   -6.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6613   -6.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2501   -6.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4237   -6.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0126   -6.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4237   -7.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2501   -7.5861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8989   -7.5861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8989   -6.1549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0126   -8.2996    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.0126   -5.4414    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.1829   -6.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7751   -7.5784    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.9488   -7.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4533   -8.2374    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6719   -7.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6831   -7.1445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4697   -6.9028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9732   -6.7243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2563   -7.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2451   -7.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9551   -8.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4783   -9.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6991   -9.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1408   -9.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3866  -10.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1909  -10.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7492   -9.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5034   -9.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4367  -11.3883    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.5502   -9.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7271   -9.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3212   -9.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7385  -10.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5617  -10.5217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9715   -9.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3327  -11.2483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5096  -11.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4941   -9.8306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0883  -10.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
  6 10  1  0
  4 11  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 14 18  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 16 22  1  0
 17 19  1  0
 22 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 27 30  1  0
 15 24  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 31 36  2  0
 37 38  1  0
 34 37  1  0
 39 40  1  0
 33 39  1  0
 22 31  1  0
 13 14  1  0
 12 13  1  0
  5 12  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4088541

   4-[[7-(3,4-dimethoxyphenyl)-1-(4-fluorophenyl)-7-methyl-5,6-dihydro-4H-benzimidazol-2-yl]sulfanylmethyl]-3,5-difluorobenzoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 568.62

Molecular Weight (Monoisotopic): 568.1644

AlogP: 6.94

#Rotatable Bonds: 8

Polar Surface Area: 73.58

Molecular Species: ACID

HBA: 6

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 6

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 3.37

CX Basic pKa: 4.34

CX LogP: 6.34

CX LogD: 4.03

Aromatic Rings: 4

Heavy Atoms: 40

QED Weighted: 0.23

Np Likeness Score: -0.69

References

1. Zhang X, Wall M, Sui Z, Kauffman J, Hou C, Chen C, Du F, Kirchner T, Liang Y, Johnson DL, Murray WV, Demarest K..  (2017)  Discovery of Orally Efficacious Tetrahydrobenzimidazoles as TGR5 Agonists for Type 2 Diabetes.,  8  (5): [PMID:28523111] [10.1021/acsmedchemlett.7b00116]

Source

Source(1):

• Scientific Literature