4-(2-((2,2-difluorocyclopropyl)methoxy)-5-(ethylsulfonyl)phenyl)-2-(3-(dimethylamino)prop-1-ynyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7(6H)-one

ID: ALA4088597

PubChem CID: 86581390

Max Phase: Preclinical

Molecular Formula: C25H27F2N3O4S

Molecular Weight: 503.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCS(=O)(=O)c1ccc(OCC2CC2(F)F)c(-c2cn(C)c(=O)c3[nH]c(C#CCN(C)C)cc23)c1

Standard InChI:  InChI=1S/C25H27F2N3O4S/c1-5-35(32,33)18-8-9-22(34-15-16-13-25(16,26)27)19(12-18)21-14-30(4)24(31)23-20(21)11-17(28-23)7-6-10-29(2)3/h8-9,11-12,14,16,28H,5,10,13,15H2,1-4H3

Standard InChI Key:  GYXDBZSTIOVMLS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    9.1212  -11.3334    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7031  -10.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9117  -10.5405    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.5203  -10.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1117  -10.0478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1758  -11.6635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7714  -12.3734    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.5884  -12.3688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2310  -11.1646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9372  -10.7534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6464  -11.1593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6461  -11.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3546  -12.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0617  -11.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0560  -11.1473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3470  -10.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3420   -9.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3329   -8.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6271   -8.7076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6308   -9.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0425   -8.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0436   -9.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8147   -9.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2903   -9.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8129   -8.4485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3287   -7.4767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9171   -8.3029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7756  -13.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4855  -13.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1075   -9.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9216   -9.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7388   -9.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1474   -9.8082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9646   -9.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7388  -10.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  2  1  0
  5  4  1  0
  2  5  1  0
  7  6  2  0
  8  7  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 17 22  1  0
 17 20  2  0
 21 18  1  0
 18 19  1  0
 19 20  1  0
 16 17  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 18 26  2  0
 19 27  1  0
 14  7  1  0
  7 28  1  0
 28 29  1  0
 24 30  1  0
 30 31  3  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
  9  4  1  0
M  END

Associated Targets(Human)

MX1 (889 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.57Molecular Weight (Monoisotopic): 503.1690AlogP: 3.27#Rotatable Bonds: 7
Polar Surface Area: 84.40Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.62CX Basic pKa: 7.85CX LogP: 2.15CX LogD: 1.57
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.50Np Likeness Score: -0.61

References

1. Liu Z, Wang P, Chen H, Wold EA, Tian B, Brasier AR, Zhou J..  (2017)  Drug Discovery Targeting Bromodomain-Containing Protein 4.,  60  (11): [PMID:28195723] [10.1021/acs.jmedchem.6b01761]

Source