The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-((2,2-difluorocyclopropyl)methoxy)-5-(ethylsulfonyl)phenyl)-2-(3-(dimethylamino)prop-1-ynyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7(6H)-one ID: ALA4088597
PubChem CID: 86581390
Max Phase: Preclinical
Molecular Formula: C25H27F2N3O4S
Molecular Weight: 503.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)c1ccc(OCC2CC2(F)F)c(-c2cn(C)c(=O)c3[nH]c(C#CCN(C)C)cc23)c1
Standard InChI: InChI=1S/C25H27F2N3O4S/c1-5-35(32,33)18-8-9-22(34-15-16-13-25(16,26)27)19(12-18)21-14-30(4)24(31)23-20(21)11-17(28-23)7-6-10-29(2)3/h8-9,11-12,14,16,28H,5,10,13,15H2,1-4H3
Standard InChI Key: GYXDBZSTIOVMLS-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
9.1212 -11.3334 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7031 -10.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9117 -10.5405 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.5203 -10.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1117 -10.0478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1758 -11.6635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7714 -12.3734 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.5884 -12.3688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2310 -11.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9372 -10.7534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6464 -11.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6461 -11.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3546 -12.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0617 -11.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0560 -11.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3470 -10.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3420 -9.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3329 -8.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6271 -8.7076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6308 -9.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0425 -8.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0436 -9.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8147 -9.7599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2903 -9.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8129 -8.4485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3287 -7.4767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9171 -8.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7756 -13.1909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4855 -13.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1075 -9.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9216 -9.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7388 -9.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1474 -9.8082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9646 -9.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7388 -10.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
5 4 1 0
2 5 1 0
7 6 2 0
8 7 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
17 22 1 0
17 20 2 0
21 18 1 0
18 19 1 0
19 20 1 0
16 17 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
18 26 2 0
19 27 1 0
14 7 1 0
7 28 1 0
28 29 1 0
24 30 1 0
30 31 3 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 1 0
9 4 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.57Molecular Weight (Monoisotopic): 503.1690AlogP: 3.27#Rotatable Bonds: 7Polar Surface Area: 84.40Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.62CX Basic pKa: 7.85CX LogP: 2.15CX LogD: 1.57Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.50Np Likeness Score: -0.61
References 1. Liu Z, Wang P, Chen H, Wold EA, Tian B, Brasier AR, Zhou J.. (2017) Drug Discovery Targeting Bromodomain-Containing Protein 4., 60 (11): [PMID:28195723 ] [10.1021/acs.jmedchem.6b01761 ]